The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Cyclopentyl-1-(1-((1-(4-(pyridin-4-ylsulfonyl)phenyl)azetidin-3-yl)methyl)piperidin-4-yl)-1,2,3,4-tetrahydroisoquinoline ID: ALA4476073
PubChem CID: 138618542
Max Phase: Preclinical
Molecular Formula: C34H42N4O2S
Molecular Weight: 570.80
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1ccncc1)c1ccc(N2CC(CN3CCC(C4(C5CCCC5)NCCc5ccccc54)CC3)C2)cc1
Standard InChI: InChI=1S/C34H42N4O2S/c39-41(40,32-14-18-35-19-15-32)31-11-9-30(10-12-31)38-24-26(25-38)23-37-21-16-29(17-22-37)34(28-6-2-3-7-28)33-8-4-1-5-27(33)13-20-36-34/h1,4-5,8-12,14-15,18-19,26,28-29,36H,2-3,6-7,13,16-17,20-25H2
Standard InChI Key: NIMLAJOQSRTWMK-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 47 0 0 0 0 0 0 0 0999 V2000
16.0670 -24.9501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6543 -24.3671 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.8557 -24.1500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8539 -28.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8528 -29.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5672 -29.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2833 -29.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5654 -28.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2795 -28.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9872 -28.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9870 -27.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2729 -26.9059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5590 -27.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1386 -26.5993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4737 -25.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8514 -25.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1316 -25.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3092 -26.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7554 -27.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1734 -26.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3727 -27.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1477 -27.9403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7298 -28.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5369 -28.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3489 -28.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7723 -27.5553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7849 -26.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9604 -26.7241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9511 -27.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3838 -26.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6097 -25.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0339 -24.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2342 -24.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0133 -25.7561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5907 -26.3419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8781 -23.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6758 -23.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8998 -22.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3247 -21.9902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5226 -22.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3023 -22.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 4 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
13 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 26 1 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 2 1 0
2 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.80Molecular Weight (Monoisotopic): 570.3028AlogP: 5.29#Rotatable Bonds: 7Polar Surface Area: 65.54Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.96CX LogP: 5.24CX LogD: 2.05Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.42Np Likeness Score: -0.66
References 1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S.. (2019) Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction., 62 (13): [PMID:31244110 ] [10.1021/acs.jmedchem.9b00021 ]