(E)-N-(5-(3-(4-fluorophenyl)acryloyl)-4-methylthiazol-2-yl)benzamide

ID: ALA4476080

PubChem CID: 155537759

Max Phase: Preclinical

Molecular Formula: C20H15FN2O2S

Molecular Weight: 366.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(NC(=O)c2ccccc2)sc1C(=O)/C=C/c1ccc(F)cc1

Standard InChI:  InChI=1S/C20H15FN2O2S/c1-13-18(17(24)12-9-14-7-10-16(21)11-8-14)26-20(22-13)23-19(25)15-5-3-2-4-6-15/h2-12H,1H3,(H,22,23,25)/b12-9+

Standard InChI Key:  SHZBNJLCLBIWMX-FMIVXFBMSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   17.8874   -3.0129    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.2204   -3.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4747   -4.2758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2960   -4.2758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5503   -3.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7761   -4.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2535   -3.0789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9656   -3.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2448   -2.2618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6689   -3.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3809   -3.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5089   -3.0830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8007   -3.4907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0935   -3.0813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7997   -4.3079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0975   -2.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3911   -1.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6819   -2.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6835   -3.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3905   -3.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3850   -4.2810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0963   -4.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8005   -4.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7891   -3.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0773   -3.0471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5131   -4.6657    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  1  2  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  4  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  2  0
 10 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 14  1  0
 11 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 11  1  0
 23 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476080

    ---

Associated Targets(Human)

ALOX5 Tclin Arachidonate 5-lipoxygenase (6568 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 366.42Molecular Weight (Monoisotopic): 366.0838AlogP: 4.74#Rotatable Bonds: 5
Polar Surface Area: 59.06Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.75CX Basic pKa: CX LogP: 4.73CX LogD: 4.73
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.52Np Likeness Score: -1.58

References

1. Sinha S, Manju SL, Doble M..  (2019)  Chalcone-Thiazole Hybrids: Rational Design, Synthesis, and Lead Identification against 5-Lipoxygenase.,  10  (10): [PMID:31620227] [10.1021/acsmedchemlett.9b00193]

Source