The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(2-hydroxy-4-((6-(pyrrolidin-1-yl)hexyl)oxy)phenyl)-3-phenylprop-2-en-1-one ID: ALA4476091
PubChem CID: 155538194
Max Phase: Preclinical
Molecular Formula: C25H31NO3
Molecular Weight: 393.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccccc1)c1ccc(OCCCCCCN2CCCC2)cc1O
Standard InChI: InChI=1S/C25H31NO3/c27-24(15-12-21-10-4-3-5-11-21)23-14-13-22(20-25(23)28)29-19-9-2-1-6-16-26-17-7-8-18-26/h3-5,10-15,20,28H,1-2,6-9,16-19H2/b15-12+
Standard InChI Key: RDXMXMFYYIGFGR-NTCAYCPXSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
33.1774 -3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1762 -4.2534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8843 -4.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5939 -4.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5911 -3.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8825 -3.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2973 -3.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0065 -3.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7127 -3.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4219 -3.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4219 -4.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1303 -4.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8375 -4.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8317 -3.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1228 -3.0066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4682 -4.6614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7608 -4.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0528 -4.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3454 -4.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6374 -4.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9300 -4.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2219 -4.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5146 -4.2489 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4320 -3.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6328 -3.2635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2236 -3.9710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7700 -4.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3023 -4.6604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2942 -2.2018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
4 28 1 0
7 29 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.53Molecular Weight (Monoisotopic): 393.2304AlogP: 5.32#Rotatable Bonds: 11Polar Surface Area: 49.77Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.10CX Basic pKa: 10.13CX LogP: 4.63CX LogD: 4.48Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.32Np Likeness Score: -0.29
References 1. Bai P, Wang K, Zhang P, Shi J, Cheng X, Zhang Q, Zheng C, Cheng Y, Yang J, Lu X, Sang Z.. (2019) Development of chalcone-O-alkylamine derivatives as multifunctional agents against Alzheimer's disease., 183 [PMID:31581002 ] [10.1016/j.ejmech.2019.111737 ]