6-(3-bromobenzyl)-1-ethyl-3-(4-fluorobenzyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione

ID: ALA4476124

PubChem CID: 155538396

Max Phase: Preclinical

Molecular Formula: C23H23BrFN3O2

Molecular Weight: 472.36

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1c2c(c(=O)n(Cc3ccc(F)cc3)c1=O)CN(Cc1cccc(Br)c1)CC2

Standard InChI:  InChI=1S/C23H23BrFN3O2/c1-2-27-21-10-11-26(13-17-4-3-5-18(24)12-17)15-20(21)22(29)28(23(27)30)14-16-6-8-19(25)9-7-16/h3-9,12H,2,10-11,13-15H2,1H3

Standard InChI Key:  WRNLQOLHBWOQAQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   16.7607  -13.2154    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7607  -14.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4660  -14.4370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4660  -12.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1712  -13.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1678  -14.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5833  -13.2214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8768  -12.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5798  -14.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8703  -14.4424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8791  -11.9903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2932  -12.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0518  -12.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2854  -14.4508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8660  -15.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1561  -15.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9987  -13.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9923  -14.0460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6970  -14.4582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4078  -14.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4095  -13.2319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7042  -12.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3453  -13.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6369  -12.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9309  -13.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9329  -14.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6467  -14.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3499  -14.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1139  -14.4647    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.2222  -12.8130    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  5  8  1  0
  6 10  1  0
  9  7  1  0
  7  8  1  0
  9 10  1  0
  8 11  2  0
  7 12  1  0
  1 13  1  0
  9 14  2  0
 10 15  1  0
 15 16  1  0
 12 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 13 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 20 29  1  0
 25 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476124

    ---

Associated Targets(Human)

NCI-H3122 (436 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.36Molecular Weight (Monoisotopic): 471.0958AlogP: 3.54#Rotatable Bonds: 5
Polar Surface Area: 47.24Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.97CX LogP: 3.87CX LogD: 3.73
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.57Np Likeness Score: -1.62

References

1. Ma Z, Gao G, Fang K, Sun H..  (2019)  Development of Novel Anticancer Agents with a Scaffold of Tetrahydropyrido[4,3-d]pyrimidine-2,4-dione.,  10  (2): [PMID:30783502] [10.1021/acsmedchemlett.8b00531]

Source