(R)-1-(6-((S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-ylamino)-6-oxohexylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-aminium

ID: ALA4476130

PubChem CID: 155538419

Max Phase: Preclinical

Molecular Formula: C28H34N6O3

Molecular Weight: 502.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CCCCCNC(=O)[C@H](N)Cc1c[nH]c2ccccc12

Standard InChI:  InChI=1S/C28H34N6O3/c29-22(14-18-16-32-23-10-5-3-8-20(18)23)28(37)31-13-7-1-2-12-26(35)34-25(27(30)36)15-19-17-33-24-11-6-4-9-21(19)24/h3-6,8-11,16-17,22,25,32-33H,1-2,7,12-15,29H2,(H2,30,36)(H,31,37)(H,34,35)/t22-,25+/m1/s1

Standard InChI Key:  XMRDJJUAWBVRBY-RDGATRHJSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   10.0098  -14.3941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0098  -15.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3007  -15.6240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3007  -16.4453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5875  -17.6752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5875  -16.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0098  -16.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3400  -18.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0098  -17.6752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5884  -18.9291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6629  -18.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4056  -18.9370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9532  -19.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7581  -19.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0112  -18.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4657  -17.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8784  -16.4453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7174  -15.6243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4252  -15.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1328  -15.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8407  -15.2166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5482  -15.6255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2563  -15.2207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9684  -13.1724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9684  -13.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5461  -13.9937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2552  -14.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6775  -14.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1350  -14.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3866  -13.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6812  -13.7281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4757  -13.1793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2785  -13.0163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5379  -12.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9944  -11.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1916  -11.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9322  -12.5610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  6 17  1  0
  2  1  2  0
  4  3  1  1
  4  6  1  0
  6  5  2  0
  4  7  1  0
  7  9  1  0
  8  9  2  0
  9 11  1  0
 10  8  1  0
 12 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  2 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 27 23  1  0
 25 24  1  6
 25 27  1  0
 27 26  2  0
 25 28  1  0
 28 30  1  0
 29 30  2  0
 30 32  1  0
 31 29  1  0
 33 31  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476130

    ---

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 reverse transcriptase (18245 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.62Molecular Weight (Monoisotopic): 502.2692AlogP: 2.41#Rotatable Bonds: 13
Polar Surface Area: 158.89Molecular Species: NEUTRALHBA: 4HBD: 6
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.74CX Basic pKa: 7.96CX LogP: 1.90CX LogD: 1.23
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: -0.14

References

1. Jain N, Friedman SH..  (2019)  Multiple weak intercalation as a strategy for the inhibition of polymerases.,  29  (3): [PMID:30579791] [10.1016/j.bmcl.2018.12.027]

Source