9-(2-Methoxyphenyl)-8-oxo-2-(pyridin-4-yl)-8,9-dihydro-7H-purine-6-carboxamide

ID: ALA4476132

Cas Number: 869069-51-2

PubChem CID: 7196976

Max Phase: Preclinical

Molecular Formula: C18H14N6O3

Molecular Weight: 362.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1-n1c(=O)[nH]c2c(C(N)=O)nc(-c3ccncc3)nc21

Standard InChI:  InChI=1S/C18H14N6O3/c1-27-12-5-3-2-4-11(12)24-17-14(22-18(24)26)13(15(19)25)21-16(23-17)10-6-8-20-9-7-10/h2-9H,1H3,(H2,19,25)(H,22,26)

Standard InChI Key:  AGLIYPCDJKUNQG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    6.2195   -5.0131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9291   -4.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9263   -3.7810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2177   -3.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5114   -4.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5126   -3.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7321   -3.5282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2485   -4.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7301   -4.8567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2159   -2.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9227   -2.1484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5073   -2.1515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4313   -4.1906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4795   -5.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6786   -5.7964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4248   -6.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9710   -7.1815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7742   -7.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0242   -6.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6340   -5.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6339   -5.8287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3414   -6.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0495   -5.8264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0455   -5.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3375   -4.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8233   -6.0626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3709   -6.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  4 10  1  0
 10 11  1  0
 10 12  2  0
  8 13  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  9 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  2 20  1  0
 19 26  1  0
 26 27  1  0
M  END

Associated Targets(Human)

NCI-H1975 (4994 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.35Molecular Weight (Monoisotopic): 362.1127AlogP: 1.28#Rotatable Bonds: 4
Polar Surface Area: 128.78Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.13CX Basic pKa: 3.24CX LogP: 2.64CX LogD: 2.64
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.56Np Likeness Score: -1.46

References

1. Huang MR, Hsu YL, Lin TC, Cheng TJ, Li LW, Tseng YW, Chou YS, Liu JH, Pan SH, Fang JM, Wong CH..  (2019)  Structure-guided development of purine amide, hydroxamate, and amidoxime for the inhibition of non-small cell lung cancer.,  181  [PMID:31376567] [10.1016/j.ejmech.2019.07.054]

Source