The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-(tert-butyl)benzamido)phenyl)-N-isopropyl-4-((4-morpholinophenyl)amino)thiazole-5-carboxamide ID: ALA4476146
PubChem CID: 155538200
Max Phase: Preclinical
Molecular Formula: C34H39N5O3S
Molecular Weight: 597.79
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)NC(=O)c1sc(-c2cccc(NC(=O)c3ccc(C(C)(C)C)cc3)c2)nc1Nc1ccc(N2CCOCC2)cc1
Standard InChI: InChI=1S/C34H39N5O3S/c1-22(2)35-32(41)29-30(36-26-13-15-28(16-14-26)39-17-19-42-20-18-39)38-33(43-29)24-7-6-8-27(21-24)37-31(40)23-9-11-25(12-10-23)34(3,4)5/h6-16,21-22,36H,17-20H2,1-5H3,(H,35,41)(H,37,40)
Standard InChI Key: ZXJIJNHXMGZWCG-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
17.5814 -9.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5802 -10.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2950 -10.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0114 -10.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0085 -9.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2932 -8.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7215 -8.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4374 -9.2781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7183 -8.0434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1503 -8.8630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8648 -9.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5771 -8.8617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5745 -8.0358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8535 -7.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1440 -8.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2930 -9.2719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3785 -10.0901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1860 -10.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5961 -9.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0420 -8.9320 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.5241 -11.0116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3448 -11.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6794 -11.8462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4993 -11.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9830 -11.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6407 -10.5052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8218 -10.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4177 -9.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9049 -10.1174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7507 -8.6968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8038 -11.3430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1420 -12.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9591 -12.1835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4446 -11.5160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1070 -10.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2838 -10.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8654 -10.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1513 -10.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8648 -11.3514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1453 -10.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5709 -8.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9039 -7.8530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0581 -9.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
12 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 1 0
18 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
28 29 2 0
28 30 1 0
19 28 1 0
25 31 1 0
31 32 1 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
2 37 1 0
37 38 1 0
37 39 1 0
37 40 1 0
30 41 1 0
41 42 1 0
41 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.79Molecular Weight (Monoisotopic): 597.2774AlogP: 7.08#Rotatable Bonds: 8Polar Surface Area: 95.59Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.39CX LogP: 8.50CX LogD: 8.50Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.20Np Likeness Score: -1.82
References 1. Guo X, Yang D, Fan Z, Zhang N, Zhao B, Huang C, Wang F, Ma R, Meng M, Deng Y.. (2019) Discovery and structure-activity relationship of novel diphenylthiazole derivatives as BTK inhibitor with potent activity against B cell lymphoma cell lines., 178 [PMID:31234030 ] [10.1016/j.ejmech.2019.06.035 ]