The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[2-(3,5-dimethoxyphenyl)vinyl]quinolin-8-yl acetate ID: ALA4476159
PubChem CID: 155538231
Max Phase: Preclinical
Molecular Formula: C21H19NO4
Molecular Weight: 349.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/c2ccc3cccc(OC(C)=O)c3n2)cc(OC)c1
Standard InChI: InChI=1S/C21H19NO4/c1-14(23)26-20-6-4-5-16-8-10-17(22-21(16)20)9-7-15-11-18(24-2)13-19(12-15)25-3/h4-13H,1-3H3/b9-7+
Standard InChI Key: KEZZKEZFVBDUNV-VQHVLOKHSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
3.2467 -9.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2456 -10.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9536 -10.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9518 -9.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6604 -9.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6612 -10.4690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3697 -10.8760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0780 -10.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0733 -9.6431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3642 -9.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7873 -10.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4934 -10.4597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2027 -10.8655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2012 -11.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9097 -12.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6168 -11.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6110 -10.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9019 -10.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9555 -11.6992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2487 -12.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5401 -11.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2506 -12.9267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3156 -10.4403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0263 -10.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9125 -12.9041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2061 -13.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
3 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
17 23 1 0
23 24 1 0
15 25 1 0
25 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 349.39Molecular Weight (Monoisotopic): 349.1314AlogP: 4.35#Rotatable Bonds: 5Polar Surface Area: 57.65Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.10CX LogP: 4.00CX LogD: 4.00Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.51Np Likeness Score: -0.27
References 1. Mrozek-Wilczkiewicz A, Kuczak M, Malarz K, Cieślik W, Spaczyńska E, Musiol R.. (2019) The synthesis and anticancer activity of 2-styrylquinoline derivatives. A p53 independent mechanism of action., 177 [PMID:31158748 ] [10.1016/j.ejmech.2019.05.061 ]