The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-[3-(1H-indol-3-yl)-1-piperidyl]butyl]-4-phenyl-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione ID: ALA4476164
PubChem CID: 155538236
Max Phase: Preclinical
Molecular Formula: C31H36N4O2
Molecular Weight: 496.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c(-c2ccccc2)c2n(c(=O)n1CCCCN1CCCC(c3c[nH]c4ccccc34)C1)CCCC2
Standard InChI: InChI=1S/C31H36N4O2/c36-30-29(23-11-2-1-3-12-23)28-16-6-7-19-34(28)31(37)35(30)20-9-8-17-33-18-10-13-24(22-33)26-21-32-27-15-5-4-14-25(26)27/h1-5,11-12,14-15,21,24,32H,6-10,13,16-20,22H2
Standard InChI Key: DSIMOSUKRNEDEJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
2.6290 -4.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6290 -5.3613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3343 -5.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3343 -4.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0396 -4.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0361 -5.3613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7382 -5.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4482 -5.3673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4517 -4.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7451 -4.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7481 -3.3217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4586 -2.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4613 -2.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -1.6878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0429 -2.0988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0438 -2.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1615 -4.1452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7336 -6.5878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1536 -5.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8636 -5.3752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5690 -5.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2790 -5.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9844 -5.7958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9739 -6.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6752 -7.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3876 -6.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3942 -5.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6884 -5.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6695 -7.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0040 -8.3206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2492 -9.1001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3261 -8.3330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0642 -9.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6023 -9.7175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4024 -9.5569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6616 -8.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1217 -8.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 10 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
10 11 1 0
9 17 2 0
7 18 2 0
8 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
29 30 2 0
30 31 1 0
31 33 1 0
32 29 1 0
25 29 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.66Molecular Weight (Monoisotopic): 496.2838AlogP: 5.15#Rotatable Bonds: 7Polar Surface Area: 63.03Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.01CX LogP: 5.00CX LogD: 2.44Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -0.80
References 1. Ślifirski G, Król M, Kleps J, Podsadni P, Belka M, Bączek T, Siwek A, Stachowicz K, Szewczyk B, Nowak G, Bojarski A, Kozioł AE, Turło J, Herold F.. (2019) Synthesis of new 5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine derivatives with rigidized tryptamine moiety as potential SSRI and 5-HT1A receptor ligands., 180 [PMID:31325785 ] [10.1016/j.ejmech.2019.07.027 ]