The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Polycycloiridal N ID: ALA4476174
PubChem CID: 155538156
Max Phase: Preclinical
Molecular Formula: C30H44O5
Molecular Weight: 484.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@H]1CC[C@@](C)(O)[C@@H]1/C=C/C(C)=C/[C@@H]1C[C@@]23[C@H](OCCC[C@@H]2/C(=C(\C)C=O)CC[C@]3(C)O)O1
Standard InChI: InChI=1S/C30H44O5/c1-19(2)23-11-13-28(5,32)25(23)10-9-20(3)16-22-17-30-26(8-7-15-34-27(30)35-22)24(21(4)18-31)12-14-29(30,6)33/h9-10,16,18,22-23,25-27,32-33H,1,7-8,11-15,17H2,2-6H3/b10-9+,20-16+,24-21+/t22-,23-,25-,26-,27-,28-,29+,30+/m1/s1
Standard InChI Key: ULPDGPJJKVQNSL-KNSHYVFHSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
36.0101 -2.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4627 -2.3739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8328 -2.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1033 -4.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8086 -5.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5139 -4.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5139 -4.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3962 -5.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6879 -4.8569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3974 -6.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1010 -4.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3818 -3.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0355 -3.1694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2878 -2.2291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4052 -2.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8098 -3.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7102 -3.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0288 -3.1903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3230 -2.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3220 -3.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7178 -2.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4255 -2.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1332 -2.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4255 -3.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8409 -2.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5489 -1.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5486 -2.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8036 -2.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3242 -1.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8512 -1.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8707 -0.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1339 -1.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2164 -3.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2990 -4.2469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8256 -1.9481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
34.8049 -4.4492 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
32.6903 -6.4913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
11 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 16 1 0
4 8 2 0
8 9 1 0
8 10 1 0
16 11 1 0
11 12 1 0
12 13 1 0
3 14 1 0
13 15 1 0
14 15 1 0
3 16 1 0
16 17 1 6
1 17 1 0
19 18 1 0
21 22 2 0
22 23 1 0
22 24 1 0
23 25 2 0
27 25 1 6
26 27 1 0
27 19 1 0
19 28 1 0
28 29 1 0
29 26 1 0
19 20 1 6
26 30 1 1
30 31 1 0
30 32 2 0
1 21 1 6
7 33 1 6
7 34 1 0
3 35 1 1
11 36 1 6
10 37 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.68Molecular Weight (Monoisotopic): 484.3189AlogP: 5.43#Rotatable Bonds: 5Polar Surface Area: 75.99Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.08CX LogD: 4.08Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: 2.93
References 1. Li J, Ni G, Liu Y, Mai Z, Wang R, Yu D.. (2019) Iridal-Type Triterpenoids with a Cyclopentane Unit from the Rhizomes of Belamcanda chinensis., 82 (7): [PMID:31246464 ] [10.1021/acs.jnatprod.8b00993 ]