The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-([1,4'-Bipiperidin]-1'-yl)-2-chloro-7-(4-fluorobenzyl)-7H-pyrrolo[2,3-d]pyrimidine ID: ALA4476179
PubChem CID: 155538173
Max Phase: Preclinical
Molecular Formula: C23H27ClFN5
Molecular Weight: 427.95
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc(Cn2ccc3c(N4CCC(N5CCCCC5)CC4)nc(Cl)nc32)cc1
Standard InChI: InChI=1S/C23H27ClFN5/c24-23-26-21(29-13-8-19(9-14-29)28-11-2-1-3-12-28)20-10-15-30(22(20)27-23)16-17-4-6-18(25)7-5-17/h4-7,10,15,19H,1-3,8-9,11-14,16H2
Standard InChI Key: QIHGFSRFUIRMKU-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
20.5619 -14.3215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5619 -15.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2671 -15.5431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9724 -15.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9724 -14.3215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2671 -13.9088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2674 -16.3608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5579 -16.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5559 -17.5818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2618 -17.9942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9713 -17.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9750 -16.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2615 -18.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5506 -19.2142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5472 -20.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2539 -20.4427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9654 -19.2173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9687 -20.0365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7489 -20.2865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2277 -19.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7435 -18.9611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0045 -21.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8045 -21.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0582 -22.0041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8574 -22.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4027 -21.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1432 -20.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3446 -20.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2029 -21.7268 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.8377 -20.4362 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
3 7 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 18 1 0
17 13 1 0
10 13 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 17 1 0
19 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
15 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.95Molecular Weight (Monoisotopic): 427.1939AlogP: 4.73#Rotatable Bonds: 4Polar Surface Area: 37.19Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.78CX LogP: 5.10CX LogD: 2.74Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.42
References 1. Frank A, Meza-Arriagada F, Salas CO, Espinosa-Bustos C, Stark H.. (2019) Nature-inspired pyrrolo[2,3-d]pyrimidines targeting the histamine H3 receptor., 27 (14): [PMID:31176569 ] [10.1016/j.bmc.2019.05.042 ]