The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(5,5'-(butane-1,4-diyl)bis(1,3,4-thiadiazole-5,2-diyl))bis(5-oxo-5-phenylpentanamide) ID: ALA4476215
PubChem CID: 90165506
Max Phase: Preclinical
Molecular Formula: C30H32N6O4S2
Molecular Weight: 604.76
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCC(=O)c1ccccc1)Nc1nnc(CCCCc2nnc(NC(=O)CCCC(=O)c3ccccc3)s2)s1
Standard InChI: InChI=1S/C30H32N6O4S2/c37-23(21-11-3-1-4-12-21)15-9-17-25(39)31-29-35-33-27(41-29)19-7-8-20-28-34-36-30(42-28)32-26(40)18-10-16-24(38)22-13-5-2-6-14-22/h1-6,11-14H,7-10,15-20H2,(H,31,35,39)(H,32,36,40)
Standard InChI Key: CGVYOAMHRNUBJQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
31.7652 -9.8427 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.4282 -9.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1738 -8.5839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3566 -8.5839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1022 -9.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4955 -10.5811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3127 -10.5811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5671 -9.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9041 -9.3222 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.2454 -9.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8300 -9.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5361 -9.3984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2715 -9.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9828 -9.7919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6869 -9.3771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3981 -9.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1334 -9.7733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8417 -9.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5488 -9.7753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8428 -8.5485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2571 -9.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1207 -9.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8331 -10.6269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4146 -9.8150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7053 -9.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9992 -9.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2899 -9.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0022 -10.6376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.9642 -9.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6725 -9.3697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3796 -9.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6737 -8.5525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2913 -8.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5829 -8.1906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8757 -8.6019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8814 -9.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5904 -9.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3764 -10.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0827 -11.0052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7919 -10.5976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7905 -9.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0836 -9.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 5 2 0
2 3 2 0
1 2 1 0
3 4 1 0
5 1 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 6 2 0
11 12 1 0
12 10 1 0
8 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 5 1 0
2 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
11 22 1 0
11 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
21 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
27 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 27 1 0
31 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 604.76Molecular Weight (Monoisotopic): 604.1926AlogP: 5.94#Rotatable Bonds: 17Polar Surface Area: 143.90Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.70CX Basic pKa: 0.22CX LogP: 4.57CX LogD: 3.58Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.11Np Likeness Score: -0.91
References 1. Zimmermann SC, Duvall B, Tsukamoto T.. (2018) Recent Progress in the Discovery of Allosteric Inhibitors of Kidney-Type Glutaminase., 62 (1): [PMID:29969024 ] [10.1021/acs.jmedchem.8b00327 ]