The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-butyl-4-chloro-1H-imidazol-5-yl)-N-(3-fluorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydro-pyrimidine-5-carboxamide ID: ALA4476223
PubChem CID: 155538401
Max Phase: Preclinical
Molecular Formula: C19H21ClFN5O2
Molecular Weight: 405.86
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1nc(Cl)c(C2NC(=O)NC(C)=C2C(=O)Nc2cccc(F)c2)[nH]1
Standard InChI: InChI=1S/C19H21ClFN5O2/c1-3-4-8-13-24-16(17(20)25-13)15-14(10(2)22-19(28)26-15)18(27)23-12-7-5-6-11(21)9-12/h5-7,9,15H,3-4,8H2,1-2H3,(H,23,27)(H,24,25)(H2,22,26,28)
Standard InChI Key: FLUCTJIXNVBQKY-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
13.9752 -12.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9719 -11.8170 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2632 -11.4149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5579 -11.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5612 -12.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2699 -13.0492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8451 -11.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8418 -10.6065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1398 -11.8345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4311 -11.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7257 -11.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0171 -11.4370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0096 -10.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7150 -10.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4236 -10.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6880 -13.0404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8559 -13.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6570 -9.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8399 -9.3399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5923 -10.1195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2558 -10.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9147 -10.1115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8573 -10.2175 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.1353 -8.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7982 -7.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2723 -7.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9353 -6.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3051 -11.8539 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 1 0
7 8 2 0
7 9 1 0
4 7 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
9 10 1 0
1 16 2 0
5 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
18 22 1 0
20 23 1 0
24 25 1 0
25 26 1 0
26 27 1 0
18 24 1 0
3 21 1 0
12 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.86Molecular Weight (Monoisotopic): 405.1368AlogP: 3.81#Rotatable Bonds: 6Polar Surface Area: 98.91Molecular Species: NEUTRALHBA: 3HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.67CX Basic pKa: 4.36CX LogP: 2.42CX LogD: 2.42Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.59Np Likeness Score: -1.66
References 1. Desai NC, Trivedi AR, Khedkar VM.. (2016) Preparation, biological evaluation and molecular docking study of imidazolyl dihydropyrimidines as potential Mycobacterium tuberculosis dihydrofolate reductase inhibitors., 26 (16): [PMID:27397497 ] [10.1016/j.bmcl.2016.06.082 ]