The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-(1,1-dioxothian-4-yl)-2-methyl-quinazolin-4-amine ID: ALA4476263
PubChem CID: 148048073
Max Phase: Preclinical
Molecular Formula: C23H25F3N4O2S
Molecular Weight: 478.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(N[C@H](C)c2cc(N)cc(C(F)(F)F)c2)c2cc(C3CCS(=O)(=O)CC3)ccc2n1
Standard InChI: InChI=1S/C23H25F3N4O2S/c1-13(17-9-18(23(24,25)26)12-19(27)10-17)28-22-20-11-16(3-4-21(20)29-14(2)30-22)15-5-7-33(31,32)8-6-15/h3-4,9-13,15H,5-8,27H2,1-2H3,(H,28,29,30)/t13-/m1/s1
Standard InChI Key: JFUPYEPKTMVHJL-CYBMUJFWSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
12.9554 -5.7410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5509 -6.4509 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.3679 -6.4462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1331 -3.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1237 -6.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5606 -7.6975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8453 -3.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9980 -8.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2825 -7.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8442 -6.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7118 -8.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2821 -3.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1304 -7.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5615 -6.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4221 -8.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8397 -6.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2819 -8.9356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5601 -8.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5599 -3.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8427 -8.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8442 -4.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9984 -7.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5617 -5.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7085 -7.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8415 -7.6890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2827 -6.4556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2849 -4.7985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4185 -7.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5513 -7.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9869 -3.5512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1362 -2.7364 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4238 -3.9594 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4232 -3.1449 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
6 18 1 0
22 9 1 0
7 4 1 0
7 21 2 0
15 28 2 0
18 17 2 0
16 5 1 0
8 11 2 0
23 27 2 0
17 8 1 0
24 22 2 0
25 29 1 0
13 25 1 0
11 15 1 0
26 9 1 0
27 12 1 0
29 2 1 0
9 6 2 0
13 28 1 0
28 24 1 0
21 23 1 0
14 26 1 0
13 5 1 0
2 16 1 0
22 8 1 0
12 19 2 0
23 14 1 0
18 20 1 0
19 7 1 0
14 10 1 6
12 30 1 0
4 31 1 0
4 32 1 0
4 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.54Molecular Weight (Monoisotopic): 478.1650AlogP: 5.00#Rotatable Bonds: 4Polar Surface Area: 97.97Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.78CX LogP: 3.71CX LogD: 3.70Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.39
References 1. (2018) Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors,