5-{[2-(4-Chlorophenyl)-1H-benzimidazol-1-yl]methyl}-4-[2-(piperidin-1-yl)ethyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione

ID: ALA4476265

PubChem CID: 155538246

Max Phase: Preclinical

Molecular Formula: C23H25ClN6S

Molecular Weight: 453.02

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  S=c1[nH]nc(Cn2c(-c3ccc(Cl)cc3)nc3ccccc32)n1CCN1CCCCC1

Standard InChI:  InChI=1S/C23H25ClN6S/c24-18-10-8-17(9-11-18)22-25-19-6-2-3-7-20(19)30(22)16-21-26-27-23(31)29(21)15-14-28-12-4-1-5-13-28/h2-3,6-11H,1,4-5,12-16H2,(H,27,31)

Standard InChI Key:  QPNJPTKXIGNIEY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   30.8712   -3.7402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0525   -3.8284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8818   -4.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5950   -5.0436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2097   -4.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1345   -4.9653    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.6790   -5.8623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0157   -6.3424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0122   -4.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3787   -4.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7090   -3.3885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0984   -2.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3893   -3.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5601   -4.0559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0984   -2.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3893   -1.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6761   -2.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6761   -2.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7873   -4.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6086   -4.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0214   -5.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6086   -6.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7873   -6.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3787   -5.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0214   -6.9845    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.0091   -7.1566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2988   -7.5567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2903   -8.3674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9902   -8.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7005   -8.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7108   -7.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  2  0
  3  6  2  0
  7  8  1  0
  4  7  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 10 14  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 12 15  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 19 24  2  0
 22 25  1  0
 10 19  1  0
  9 14  1  0
  5  9  1  0
  8 26  1  0
 26 27  1  0
 26 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476265

    ---

Associated Targets(Human)

EGFR Tclin Epidermal growth factor receptor erbB1 (33727 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.02Molecular Weight (Monoisotopic): 452.1550AlogP: 5.14#Rotatable Bonds: 6
Polar Surface Area: 54.67Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.69CX Basic pKa: 8.31CX LogP: 4.49CX LogD: 4.27
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.41Np Likeness Score: -1.97

References

1. Celik İ, Ayhan-Kılcıgil G, Guven B, Kara Z, Gurkan-Alp AS, Karayel A, Onay-Besikci A..  (2019)  Design, synthesis and docking studies of benzimidazole derivatives as potential EGFR inhibitors.,  173  [PMID:31009910] [10.1016/j.ejmech.2019.04.012]

Source