3-(4-hydroxybenzyl)-6-(4-hydroxyphenethyl)-2,2-dimethylpiperidin-4-one

ID: ALA4476273

PubChem CID: 155538347

Max Phase: Preclinical

Molecular Formula: C22H27NO3

Molecular Weight: 353.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)NC(CCc2ccc(O)cc2)CC(=O)C1Cc1ccc(O)cc1

Standard InChI:  InChI=1S/C22H27NO3/c1-22(2)20(13-16-6-11-19(25)12-7-16)21(26)14-17(23-22)8-3-15-4-9-18(24)10-5-15/h4-7,9-12,17,20,23-25H,3,8,13-14H2,1-2H3

Standard InChI Key:  ITHHUWIFVJJZCS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   36.6828  -11.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2742  -10.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8652  -11.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5726   -9.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5726  -10.4790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9873  -10.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9873   -9.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2779   -9.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7003   -9.2471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.6981  -10.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4109  -10.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1187  -10.8931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8311  -10.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8337   -9.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1179   -9.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4084   -9.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5460   -9.2530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8596   -9.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1489   -9.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4359   -9.2512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4375   -8.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7253   -8.0245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0136   -8.4352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0187   -9.2607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7314   -9.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3001   -8.0296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  8  1  0
  5  2  1  0
  2  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  6 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
  4 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476273

    ---

Associated Targets(Human)

PTGS1 Tclin Cyclooxygenase-1 (9233 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 353.46Molecular Weight (Monoisotopic): 353.1991AlogP: 3.60#Rotatable Bonds: 5
Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.48CX Basic pKa: 8.45CX LogP: 4.26CX LogD: 3.39
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.77Np Likeness Score: 0.78

References

1. Kishore N, Kumar P, Shanker K, Verma AK..  (2019)  Human disorders associated with inflammation and the evolving role of natural products to overcome.,  179  [PMID:31255927] [10.1016/j.ejmech.2019.06.034]

Source