The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{1-[8-(2-Chlorophenyl)-9-(1-methyl-1H-pyrazol-3-yl)-9H-purin-6-yl]piperidin-4-yl}-3,4-difluorobenzene-1-sulfonamide ID: ALA4476276
PubChem CID: 135156304
Max Phase: Preclinical
Molecular Formula: C26H23ClF2N8O2S
Molecular Weight: 585.04
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1ccc(-n2c(-c3ccccc3Cl)nc3c(N4CCC(NS(=O)(=O)c5ccc(F)c(F)c5)CC4)ncnc32)n1
Standard InChI: InChI=1S/C26H23ClF2N8O2S/c1-35-11-10-22(33-35)37-24(18-4-2-3-5-19(18)27)32-23-25(30-15-31-26(23)37)36-12-8-16(9-13-36)34-40(38,39)17-6-7-20(28)21(29)14-17/h2-7,10-11,14-16,34H,8-9,12-13H2,1H3
Standard InChI Key: DWPBGPAVKAXTBB-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
33.0550 -18.1185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0591 -17.3013 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.3493 -17.7064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8292 -16.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3694 -16.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1907 -16.5832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6022 -17.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4199 -17.2988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4250 -15.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6011 -15.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9626 -15.8691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1421 -15.8687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7285 -16.5811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9648 -17.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1434 -17.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8876 -18.0749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5535 -18.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2183 -18.0733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5545 -19.3759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8420 -19.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8427 -20.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5556 -21.0133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2692 -20.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2651 -19.7803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9742 -19.3629 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.6505 -16.5897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8763 -17.3013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2830 -18.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0995 -18.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5089 -17.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0959 -16.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2808 -16.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3261 -17.3024 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.5020 -15.8843 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.1697 -19.2984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1745 -18.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3997 -18.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9160 -18.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3919 -19.5460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1348 -20.3217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 6 1 0
6 7 1 0
6 10 1 0
7 8 1 0
8 4 1 0
4 9 1 0
9 10 1 0
5 11 2 0
11 12 1 0
12 13 2 0
13 15 1 0
14 5 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
24 25 1 0
36 16 1 0
4 26 1 0
26 2 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
31 34 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 35 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 585.04Molecular Weight (Monoisotopic): 584.1321AlogP: 4.09#Rotatable Bonds: 6Polar Surface Area: 110.83Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.96CX Basic pKa: 2.73CX LogP: 4.86CX LogD: 4.85Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: -2.10
References 1. Amato G, Wiethe R, Manke A, Vasukuttan V, Snyder R, Runyon S, Maitra R.. (2019) Functionalized 6-(piperidin-1-yl)-8,9-diphenyl purines as inverse agonists of the CB1 receptor - SAR efforts towards selectivity and peripheralization., 27 (16): [PMID:31301950 ] [10.1016/j.bmc.2019.07.002 ]