5'-(Cyclopropylmethoxy)-6'-(3-(isoindolin-2-yl)propoxy)spiro[cyclopentane-1,3'-indol]-2'-amine

ID: ALA4476309

PubChem CID: 137349493

Max Phase: Preclinical

Molecular Formula: C27H33N3O2

Molecular Weight: 431.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC1=Nc2cc(OCCCN3Cc4ccccc4C3)c(OCC3CC3)cc2C12CCCC2

Standard InChI:  InChI=1S/C27H33N3O2/c28-26-27(10-3-4-11-27)22-14-24(32-18-19-8-9-19)25(15-23(22)29-26)31-13-5-12-30-16-20-6-1-2-7-21(20)17-30/h1-2,6-7,14-15,19H,3-5,8-13,16-18H2,(H2,28,29)

Standard InChI Key:  BHUFHRHQTFNIPQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   26.5960   -3.4907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3092   -3.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0226   -3.4901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0226   -4.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3117   -4.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5960   -4.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8828   -4.7314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1654   -4.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4522   -4.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7390   -4.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0258   -4.7314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9359   -5.5497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1326   -5.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7181   -5.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2696   -4.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8925   -5.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4845   -5.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8942   -6.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7192   -6.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8069   -4.5674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2876   -3.9008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8069   -3.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2858   -2.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7362   -1.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5293   -2.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5293   -2.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1131   -3.9008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8828   -3.0759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1654   -3.4907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4522   -3.0759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0405   -2.3607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6268   -3.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 12 11  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
 14 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 13 19  1  0
  4 20  1  0
 21 20  2  0
 22 21  1  0
  3 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 22 26  1  0
 21 27  1  0
  1 28  1  0
 28 29  1  0
 29 30  1  0
 31 30  1  0
 31 32  1  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476309

    ---

Associated Targets(Human)

SPIN1 Tchem Spindlin-1 (66 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EHMT2 Tchem Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 (93046 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
U2OS (164939 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.58Molecular Weight (Monoisotopic): 431.2573AlogP: 5.07#Rotatable Bonds: 8
Polar Surface Area: 60.08Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.66CX LogP: 4.49CX LogD: 2.98
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: -0.38

References

1. Fagan V, Johansson C, Gileadi C, Monteiro O, Dunford JE, Nibhani R, Philpott M, Malzahn J, Wells G, Faram R, Cribbs AP, Halidi N, Li F, Chau I, Greschik H, Velupillai S, Allali-Hassani A, Bennett J, Christott T, Giroud C, Lewis AM, Huber KVM, Athanasou N, Bountra C, Jung M, Schüle R, Vedadi M, Arrowsmith C, Xiong Y, Jin J, Fedorov O, Farnie G, Brennan PE, Oppermann U..  (2019)  A Chemical Probe for Tudor Domain Protein Spindlin1 to Investigate Chromatin Function.,  62  (20): [PMID:31550156] [10.1021/acs.jmedchem.9b00562]

Source