4-(Benzo[b]thiophen-3-yl)-2-methyl-5-oxo-N-(o-tolyl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide

ID: ALA4476349

PubChem CID: 155538420

Max Phase: Preclinical

Molecular Formula: C26H24N2O2S

Molecular Weight: 428.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=C(C(=O)Nc2ccccc2C)C(c2csc3ccccc23)C2=C(CCCC2=O)N1

Standard InChI:  InChI=1S/C26H24N2O2S/c1-15-8-3-5-10-19(15)28-26(30)23-16(2)27-20-11-7-12-21(29)25(20)24(23)18-14-31-22-13-6-4-9-17(18)22/h3-6,8-10,13-14,24,27H,7,11-12H2,1-2H3,(H,28,30)

Standard InChI Key:  BGRZUHOAWVKGNV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   31.9117  -28.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9117  -29.1424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6211  -29.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6211  -27.9083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3305  -28.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3271  -29.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0333  -29.5558    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7474  -29.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7509  -28.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0402  -27.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6211  -27.0870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4528  -29.5650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4607  -27.9222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4650  -27.1009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.1704  -28.3345    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.8844  -27.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5934  -28.3439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3068  -27.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3116  -27.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5969  -26.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8863  -27.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5879  -29.1611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0410  -27.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6359  -25.8374    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   33.3813  -26.6139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4532  -25.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7024  -26.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4967  -26.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0426  -26.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7886  -25.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9949  -25.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  4 11  2  0
  8 12  1  0
  9 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 17 22  1  0
 23 27  1  0
 26 24  1  0
 24 25  1  0
 25 23  2  0
 10 23  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476349

    ---

Associated Targets(Human)

FFAR3 Tchem Free fatty acid receptor 3 (304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.56Molecular Weight (Monoisotopic): 428.1558AlogP: 5.82#Rotatable Bonds: 3
Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.59CX LogD: 4.59
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -1.58

References

1. Ulven ER, Quon T, Sergeev E, Barki N, Brvar M, Hudson BD, Dutta P, Hansen AH, Bielefeldt LØ, Tobin AB, McKenzie CJ, Milligan G, Ulven T..  (2020)  Structure-Activity Relationship Studies of Tetrahydroquinolone Free Fatty Acid Receptor 3 Modulators.,  63  (7): [PMID:32141297] [10.1021/acs.jmedchem.9b02036]

Source