2-(tert-Butoxy)-2-(7-(chroman-6-yl)-5-methyl-2-phenylpyrazolo[1,5-a]pyrimidin-6-yl)acetic Acid

ID: ALA4476366

PubChem CID: 70660318

Max Phase: Preclinical

Molecular Formula: C28H29N3O4

Molecular Weight: 471.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc2cc(-c3ccccc3)nn2c(-c2ccc3c(c2)CCCO3)c1C(OC(C)(C)C)C(=O)O

Standard InChI:  InChI=1S/C28H29N3O4/c1-17-24(26(27(32)33)35-28(2,3)4)25(20-12-13-22-19(15-20)11-8-14-34-22)31-23(29-17)16-21(30-31)18-9-6-5-7-10-18/h5-7,9-10,12-13,15-16,26H,8,11,14H2,1-4H3,(H,32,33)

Standard InChI Key:  PAGOKHJLPJSOGR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   36.6123  -15.2527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.3286  -14.8394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3258  -14.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6104  -13.5997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8974  -14.8399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8987  -14.0155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1151  -13.7638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6295  -14.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1131  -15.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8042  -14.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3934  -13.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5692  -13.7108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1548  -14.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5707  -15.1426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3936  -15.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0438  -15.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0388  -13.5937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7547  -14.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4677  -13.5882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7579  -14.8285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0356  -12.7687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7486  -12.3534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7455  -11.5284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4646  -12.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4584  -11.9334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6052  -12.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3236  -12.3648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3160  -11.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8911  -12.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8842  -11.5508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5995  -11.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5951  -10.3098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8770   -9.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1616  -10.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1644  -11.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
  2 16  1  0
  3 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 17 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
 26 27  2  0
 27 28  1  0
 28 31  2  0
 30 29  2  0
 29 26  1  0
  4 26  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
pol Human immunodeficiency virus type 1 integrase (9041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.56Molecular Weight (Monoisotopic): 471.2158AlogP: 5.64#Rotatable Bonds: 5
Polar Surface Area: 85.95Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.68CX Basic pKa: 1.37CX LogP: 5.33CX LogD: 2.02
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.85

References

1. Li G, Meanwell NA, Krystal MR, Langley DR, Naidu BN, Sivaprakasam P, Lewis H, Kish K, Khan JA, Ng A, Trainor GL, Cianci C, Dicker IB, Walker MA, Lin Z, Protack T, Discotto L, Jenkins S, Gerritz SW, Pendri A..  (2020)  Discovery and Optimization of Novel Pyrazolopyrimidines as Potent and Orally Bioavailable Allosteric HIV-1 Integrase Inhibitors.,  63  (5): [PMID:32081010] [10.1021/acs.jmedchem.9b01681]

Source