The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(tert-Butoxy)-2-(7-(chroman-6-yl)-5-methyl-2-phenylpyrazolo[1,5-a]pyrimidin-6-yl)acetic Acid ID: ALA4476366
PubChem CID: 70660318
Max Phase: Preclinical
Molecular Formula: C28H29N3O4
Molecular Weight: 471.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2cc(-c3ccccc3)nn2c(-c2ccc3c(c2)CCCO3)c1C(OC(C)(C)C)C(=O)O
Standard InChI: InChI=1S/C28H29N3O4/c1-17-24(26(27(32)33)35-28(2,3)4)25(20-12-13-22-19(15-20)11-8-14-34-22)31-23(29-17)16-21(30-31)18-9-6-5-7-10-18/h5-7,9-10,12-13,15-16,26H,8,11,14H2,1-4H3,(H,32,33)
Standard InChI Key: PAGOKHJLPJSOGR-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
36.6123 -15.2527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3286 -14.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3258 -14.0088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6104 -13.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8974 -14.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8987 -14.0155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1151 -13.7638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6295 -14.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1131 -15.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8042 -14.4291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3934 -13.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5692 -13.7108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1548 -14.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5707 -15.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3936 -15.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0438 -15.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0388 -13.5937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7547 -14.0035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4677 -13.5882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7579 -14.8285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.0356 -12.7687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7486 -12.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7455 -11.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4646 -12.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4584 -11.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6052 -12.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3236 -12.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3160 -11.5406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8911 -12.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8842 -11.5508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5995 -11.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5951 -10.3098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8770 -9.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1616 -10.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1644 -11.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
2 16 1 0
3 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
17 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
26 27 2 0
27 28 1 0
28 31 2 0
30 29 2 0
29 26 1 0
4 26 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.56Molecular Weight (Monoisotopic): 471.2158AlogP: 5.64#Rotatable Bonds: 5Polar Surface Area: 85.95Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.68CX Basic pKa: 1.37CX LogP: 5.33CX LogD: 2.02Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.85
References 1. Li G, Meanwell NA, Krystal MR, Langley DR, Naidu BN, Sivaprakasam P, Lewis H, Kish K, Khan JA, Ng A, Trainor GL, Cianci C, Dicker IB, Walker MA, Lin Z, Protack T, Discotto L, Jenkins S, Gerritz SW, Pendri A.. (2020) Discovery and Optimization of Novel Pyrazolopyrimidines as Potent and Orally Bioavailable Allosteric HIV-1 Integrase Inhibitors., 63 (5): [PMID:32081010 ] [10.1021/acs.jmedchem.9b01681 ]