4-(4-bromophenyl)-1-(4-methoxyphenyl)-5-methylene-1H-pyrrol-2(5H)-one

ID: ALA4476411

PubChem CID: 155538352

Max Phase: Preclinical

Molecular Formula: C18H14BrNO2

Molecular Weight: 356.22

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(c2ccc(Br)cc2)=CC(=O)N1c1ccc(OC)cc1

Standard InChI:  InChI=1S/C18H14BrNO2/c1-12-17(13-3-5-14(19)6-4-13)11-18(21)20(12)15-7-9-16(22-2)10-8-15/h3-11H,1H2,2H3

Standard InChI Key:  VRXNXCSBOHWESK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   12.8590   -8.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8579   -8.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5659   -9.3715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2756   -8.9620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2728   -8.1394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5641   -7.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1499   -9.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4081   -9.0367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8608   -9.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2689  -10.3517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0683  -10.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0482   -9.5575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6767  -10.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9400  -11.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1259  -11.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7930  -11.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2730  -12.5889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0898  -12.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4189  -11.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9789   -7.7281    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    9.9411  -13.3356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1285  -13.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  9 12  2  0
 11 13  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 10 14  1  0
  5 20  1  0
 17 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476411

    ---

Associated Targets(non-human)

Pseudomonas aeruginosa (123386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 356.22Molecular Weight (Monoisotopic): 355.0208AlogP: 4.40#Rotatable Bonds: 3
Polar Surface Area: 29.54Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.80CX LogD: 3.80
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.82Np Likeness Score: -0.29

References

1. Almohaywi B, Yu TT, Iskander G, Chan DSH, Ho KKK, Rice S, Black DS, Griffith R, Kumar N..  (2019)  Dihydropyrrolones as bacterial quorum sensing inhibitors.,  29  (9): [PMID:30857746] [10.1016/j.bmcl.2019.03.004]

Source