N-[4-(1-Cyclobutylpiperidin-4-yloxy)-2-methylphenyl]-2-(piperidin-1-yl)acetamide Dihydrochloride

ID: ALA4476420

PubChem CID: 155538406

Max Phase: Preclinical

Molecular Formula: C23H37Cl2N3O2

Molecular Weight: 385.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(OC2CCN(C3CCC3)CC2)ccc1NC(=O)CN1CCCCC1.Cl.Cl

Standard InChI:  InChI=1S/C23H35N3O2.2ClH/c1-18-16-21(28-20-10-14-26(15-11-20)19-6-5-7-19)8-9-22(18)24-23(27)17-25-12-3-2-4-13-25;;/h8-9,16,19-20H,2-7,10-15,17H2,1H3,(H,24,27);2*1H

Standard InChI Key:  SLSIBCFEDLJEKB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 31  0  0  0  0  0  0  0  0999 V2000
   25.0741  -22.3045    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   22.9759  -19.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9748  -19.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6894  -20.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4059  -19.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4031  -19.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6877  -18.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2613  -18.6445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5471  -19.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8284  -18.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1162  -19.0508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1122  -19.8761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8264  -20.2906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5449  -19.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1210  -20.2950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8347  -19.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5498  -20.2927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8334  -19.0565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2635  -19.8791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3970  -20.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6010  -20.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3846  -20.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1808  -21.0799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1158  -18.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9751  -20.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6869  -19.8847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6898  -19.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9748  -18.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2570  -19.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4188  -22.3339    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  5 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 20  1  0
 12 20  1  0
  6 24  1  0
 19 25  1  0
 19 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
M  END

Associated Targets(Human)

HRH3 Tclin Histamine H3 receptor (10389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.55Molecular Weight (Monoisotopic): 385.2729AlogP: 3.82#Rotatable Bonds: 6
Polar Surface Area: 44.81Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.14CX LogP: 3.25CX LogD: 1.30
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.81Np Likeness Score: -1.44

References

1. Nirogi R, Shinde A, Mohammed AR, Badange RK, Reballi V, Bandyala TR, Saraf SK, Bojja K, Manchineella S, Achanta PK, Kandukuri KK, Subramanian R, Benade V, Palacharla RC, Jayarajan P, Pandey S, Jasti V..  (2019)  Discovery and Development of N-[4-(1-Cyclobutylpiperidin-4-yloxy)phenyl]-2-(morpholin-4-yl)acetamide Dihydrochloride (SUVN-G3031): A Novel, Potent, Selective, and Orally Active Histamine H3 Receptor Inverse Agonist with Robust Wake-Promoting Activity.,  62  (3): [PMID:30629436] [10.1021/acs.jmedchem.8b01280]

Source