N-Methyl-4-[(1-pentyl-1H-indol-3-yl)carbonyl]naphthalene-1-carboxamide

ID: ALA4476434

PubChem CID: 72948606

Max Phase: Preclinical

Molecular Formula: C26H26N2O2

Molecular Weight: 398.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCn1cc(C(=O)c2ccc(C(=O)NC)c3ccccc23)c2ccccc21

Standard InChI:  InChI=1S/C26H26N2O2/c1-3-4-9-16-28-17-23(20-12-7-8-13-24(20)28)25(29)21-14-15-22(26(30)27-2)19-11-6-5-10-18(19)21/h5-8,10-15,17H,3-4,9,16H2,1-2H3,(H,27,30)

Standard InChI Key:  WKFSYVXWVHKJGF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    2.7845  -11.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7833  -12.2106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4914  -12.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4896  -10.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1982  -11.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1984  -12.2107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9814  -12.4649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4651  -11.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9810  -11.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2333  -10.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0326  -10.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6863   -9.7486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6254   -9.8467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0736   -9.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2770   -9.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3724  -10.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5768  -10.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3254  -11.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8686  -12.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6664  -11.9960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9141  -11.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2342  -13.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0335  -13.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2863  -14.1888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0856  -14.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3384  -15.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4244   -9.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9722  -10.2819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6757   -8.8979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7713  -10.1107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 11 17  2  0
 16 13  2  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 13 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
M  END

Associated Targets(Human)

CNR1 Tclin Cannabinoid CB1 receptor (20913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.51Molecular Weight (Monoisotopic): 398.1994AlogP: 5.58#Rotatable Bonds: 7
Polar Surface Area: 51.10Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.59CX LogD: 5.59
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.33Np Likeness Score: -0.92

References

1. Seltzman HH, Shiner C, Hirt EE, Gilliam AF, Thomas BF, Maitra R, Snyder R, Black SL, Patel PR, Mulpuri Y, Spigelman I..  (2016)  Peripherally Selective Cannabinoid 1 Receptor (CB1R) Agonists for the Treatment of Neuropathic Pain.,  59  (16): [PMID:27482723] [10.1021/acs.jmedchem.6b00516]

Source