5-Fluoro-3-(4-fluorobenzyl)-1-((1-(((1aR,7aS,10aS,10bS,E)-1a-methyl-8-methylene-9-oxo-1a,2,3,6,7,7a,8,9,10a,10b-decahydrooxireno[2',3':9,10]cyclodeca[1,2-b]furan-5-yl)methyl)-1H-1,2,3-triazol-4-yl)methyl)pyrimidine-2,4(1H,3H)-dione

ID: ALA4476455

PubChem CID: 155538142

Max Phase: Preclinical

Molecular Formula: C29H29F2N5O5

Molecular Weight: 565.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1C(=O)O[C@H]2[C@H]1CC/C(Cn1cc(Cn3cc(F)c(=O)n(Cc4ccc(F)cc4)c3=O)nn1)=C\CC[C@@]1(C)O[C@@H]21

Standard InChI:  InChI=1S/C29H29F2N5O5/c1-17-22-10-7-18(4-3-11-29(2)25(41-29)24(22)40-27(17)38)12-35-15-21(32-33-35)14-34-16-23(31)26(37)36(28(34)39)13-19-5-8-20(30)9-6-19/h4-6,8-9,15-16,22,24-25H,1,3,7,10-14H2,2H3/b18-4+/t22-,24-,25-,29+/m0/s1

Standard InChI Key:  UDGKPJAUWWXSJE-LUEFZTOZSA-N

Molfile:  

 
     RDKit          2D

 44 49  0  0  0  0  0  0  0  0999 V2000
   32.0352  -22.6732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5401  -22.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7298  -21.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1848  -24.0869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8531  -23.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5263  -23.5983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7874  -22.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6035  -22.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8621  -22.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2090  -21.5644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2494  -20.7386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4212  -21.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6288  -20.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8162  -20.3405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0019  -20.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0161  -22.3159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5349  -21.2098    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.6282  -23.8703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4170  -22.8236    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.1766  -24.9041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0768  -23.1372    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.6541  -20.9125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6389  -21.7275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4113  -21.9943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9037  -21.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4356  -20.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7208  -21.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1163  -22.0721    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6947  -22.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0868  -23.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9041  -23.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3278  -22.8006    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9342  -22.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3548  -21.3808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2969  -24.2170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6626  -24.1797    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   39.1448  -22.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5379  -23.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1126  -24.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5050  -24.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3229  -24.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7467  -24.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3519  -23.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7169  -25.6824    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  6  4  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  2  7  1  0
 10 11  1  0
  3 12  1  0
 11 13  2  0
 12 14  1  0
 13 14  1  0
 11 15  1  0
  3 16  1  1
  2 17  1  1
  5 18  2  0
  8 19  1  6
  4 20  2  0
  7 21  1  1
 15 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 22  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 28 33  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 31 35  2  0
 30 36  1  0
 32 37  1  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 42  1  0
 42 43  2  0
 43 38  1  0
 41 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476455

    ---

Associated Targets(Human)

Bel7402/5-FU (373 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Bel-7402 (4577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 565.58Molecular Weight (Monoisotopic): 565.2137AlogP: 2.73#Rotatable Bonds: 6
Polar Surface Area: 113.54Molecular Species: NEUTRALHBA: 10HBD:
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.14CX LogP: 3.82CX LogD: 3.82
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.20Np Likeness Score: 0.42

References

1. Ding Y, Li S, Ge W, Liu Z, Zhang X, Wang M, Chen T, Chen Y, Zhang Q..  (2019)  Design and synthesis of parthenolide and 5-fluorouracil conjugates as potential anticancer agents against drug resistant hepatocellular carcinoma.,  183  [PMID:31553932] [10.1016/j.ejmech.2019.111706]

Source