The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R)-4,4-Difluoro-1-{[(4S)-4-(4-fluorophenyl)-5-methoxycarbonyl-4-methyl-2-thiazol-2-yl-1H-pyrimidin-6-yl]methyl}pyrrolidine-2-carboxylic Acid ID: ALA4476477
PubChem CID: 155538409
Max Phase: Preclinical
Molecular Formula: C22H23FN4O4S
Molecular Weight: 458.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C(CN2CCC[C@@H]2C(=O)O)NC(c2nccs2)=N[C@@]1(C)c1ccc(F)cc1
Standard InChI: InChI=1S/C22H23FN4O4S/c1-22(13-5-7-14(23)8-6-13)17(21(30)31-2)15(12-27-10-3-4-16(27)20(28)29)25-18(26-22)19-24-9-11-32-19/h5-9,11,16H,3-4,10,12H2,1-2H3,(H,25,26)(H,28,29)/t16-,22+/m1/s1
Standard InChI Key: GQSSEEBYBSGHIV-ZHRRBRCNSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
9.5222 -9.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0505 -8.4939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7599 -8.0893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7599 -7.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0505 -6.8476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3410 -7.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3410 -8.0893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6299 -8.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6299 -9.3173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9214 -8.0881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2144 -8.5011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6281 -6.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6281 -6.0404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9614 -5.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2172 -4.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0338 -4.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2866 -5.5544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1831 -5.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5736 -5.2598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0142 -6.6092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4694 -6.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2201 -7.1911 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.7664 -6.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3591 -5.8739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5594 -6.0414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5747 -9.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2919 -9.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8237 -10.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6348 -10.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9099 -9.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3857 -8.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1629 -11.0031 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
2 3 1 0
4 3 2 0
5 4 1 0
6 5 1 0
7 6 2 0
2 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
6 12 1 0
12 13 1 0
13 14 1 0
15 14 1 0
16 15 1 0
17 16 1 0
13 17 1 0
14 18 1 1
18 19 2 0
18 20 1 0
4 21 1 0
21 22 1 0
23 22 1 0
24 23 2 0
25 24 1 0
21 25 2 0
2 26 1 0
26 27 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.51Molecular Weight (Monoisotopic): 458.1424AlogP: 2.52#Rotatable Bonds: 6Polar Surface Area: 104.12Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.09CX Basic pKa: 5.82CX LogP: 0.54CX LogD: -0.75Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: -0.85
References 1. Qiu Z, Lin X, Zhou M, Liu Y, Zhu W, Chen W, Zhang W, Guo L, Liu H, Wu G, Huang M, Jiang M, Xu Z, Zhou Z, Qin N, Ren S, Qiu H, Zhong S, Zhang Y, Zhang Y, Wu X, Shi L, Shen F, Mao Y, Zhou X, Yang W, Wu JZ, Yang G, Mayweg AV, Shen HC, Tang G.. (2016) Design and Synthesis of Orally Bioavailable 4-Methyl Heteroaryldihydropyrimidine Based Hepatitis B Virus (HBV) Capsid Inhibitors., 59 (16): [PMID:27458651 ] [10.1021/acs.jmedchem.6b00879 ]