The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Cyclohexyl({1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)-9H-purin-6-yl]piperidin-4-yl}amino)sulfonamide ID: ALA4476491
PubChem CID: 155538267
Max Phase: Preclinical
Molecular Formula: C28H31Cl2N7O2S
Molecular Weight: 600.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(NC1CCCCC1)NC1CCN(c2ncnc3c2nc(-c2ccccc2Cl)n3-c2ccc(Cl)cc2)CC1
Standard InChI: InChI=1S/C28H31Cl2N7O2S/c29-19-10-12-22(13-11-19)37-26(23-8-4-5-9-24(23)30)33-25-27(31-18-32-28(25)37)36-16-14-21(15-17-36)35-40(38,39)34-20-6-2-1-3-7-20/h4-5,8-13,18,20-21,34-35H,1-3,6-7,14-17H2
Standard InChI Key: KHTDHNGZARZUHG-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
34.0620 -18.3744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0661 -17.5572 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.3564 -17.9623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8362 -16.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3764 -16.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1977 -16.8391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6092 -17.5527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4270 -17.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4320 -16.1310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6081 -16.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9697 -16.1250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1491 -16.1246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7356 -16.8370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9719 -17.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1504 -17.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8946 -18.3308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5606 -18.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2253 -18.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5616 -19.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8491 -20.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8497 -20.8607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5626 -21.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2763 -20.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2721 -20.0362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9813 -19.6188 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
26.7637 -18.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7625 -19.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4706 -19.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1843 -19.5649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1815 -18.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4688 -18.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0504 -19.9775 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.6575 -16.8456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8833 -17.5572 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2919 -18.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8822 -18.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2874 -19.6762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1049 -19.6805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5157 -18.9729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1089 -18.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 6 1 0
6 7 1 0
6 10 1 0
7 8 1 0
8 4 1 0
4 9 1 0
9 10 1 0
5 11 2 0
11 12 1 0
12 13 2 0
13 15 1 0
14 5 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
24 25 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
30 16 1 0
27 32 1 0
4 33 1 0
33 2 1 0
2 34 1 0
34 35 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 600.58Molecular Weight (Monoisotopic): 599.1637AlogP: 5.51#Rotatable Bonds: 7Polar Surface Area: 105.04Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.88CX Basic pKa: 2.85CX LogP: 5.61CX LogD: 5.61Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.29Np Likeness Score: -1.40
References 1. Amato G, Wiethe R, Manke A, Vasukuttan V, Snyder R, Runyon S, Maitra R.. (2019) Functionalized 6-(piperidin-1-yl)-8,9-diphenyl purines as inverse agonists of the CB1 receptor - SAR efforts towards selectivity and peripheralization., 27 (16): [PMID:31301950 ] [10.1016/j.bmc.2019.07.002 ]