The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(tert-butylamino)-8-((R)-6-methyl-4-oxo-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrol-2-yl)-3-(((S)-4-methylmorpholin-2-yl)methyl)quinazolin-4(3H)-one ID: ALA4476513
PubChem CID: 155538459
Max Phase: Preclinical
Molecular Formula: C25H32N6O3
Molecular Weight: 464.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1NC(=O)c2cc(-c3cccc4c(=O)n(C[C@@H]5CN(C)CCO5)c(NC(C)(C)C)nc34)[nH]c21
Standard InChI: InChI=1S/C25H32N6O3/c1-14-20-18(22(32)26-14)11-19(27-20)16-7-6-8-17-21(16)28-24(29-25(2,3)4)31(23(17)33)13-15-12-30(5)9-10-34-15/h6-8,11,14-15,27H,9-10,12-13H2,1-5H3,(H,26,32)(H,28,29)/t14-,15+/m1/s1
Standard InChI Key: BZUBDLKATGBRRF-CABCVRRESA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
15.8527 -9.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8527 -10.5244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5580 -10.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2632 -10.5244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5580 -9.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2609 -9.7077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9681 -9.3056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9735 -8.4905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2659 -8.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5617 -8.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6766 -9.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7566 -10.5302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4253 -9.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9681 -10.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5582 -10.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1038 -11.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8511 -10.9848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7671 -10.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9323 -12.1147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3755 -9.6263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1438 -9.3007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5580 -11.7461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2657 -12.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2657 -12.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9734 -11.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9700 -12.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1456 -10.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4373 -10.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4383 -9.7061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7341 -9.2986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0245 -9.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0238 -10.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7325 -10.9349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7360 -8.4814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 5 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 12 1 0
12 15 1 0
14 13 1 0
13 11 2 0
7 11 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
16 19 1 6
18 20 2 0
1 21 2 0
3 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
23 26 1 0
2 27 1 0
28 27 1 1
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
30 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.57Molecular Weight (Monoisotopic): 464.2536AlogP: 2.74#Rotatable Bonds: 4Polar Surface Area: 104.28Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.98CX Basic pKa: 6.54CX LogP: 1.72CX LogD: 1.66Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.55Np Likeness Score: -0.54
References 1. Wang HL, Andrews KL, Booker SK, Canon J, Cee VJ, Chavez F, Chen Y, Eastwood H, Guerrero N, Herberich B, Hickman D, Lanman BA, Laszlo J, Lee MR, Lipford JR, Mattson B, Mohr C, Nguyen Y, Norman MH, Pettus LH, Powers D, Reed AB, Rex K, Sastri C, Tamayo N, Wang P, Winston JT, Wu B, Wu Q, Wu T, Wurz RP, Xu Y, Zhou Y, Tasker AS.. (2019) Discovery of ( R)-8-(6-Methyl-4-oxo-1,4,5,6-tetrahydropyrrolo[3,4- b]pyrrol-2-yl)-3-(1-methylcyclopropyl)-2-((1-methylcyclopropyl)amino)quinazolin-4(3 H)-one, a Potent and Selective Pim-1/2 Kinase Inhibitor for Hematological Malignancies., 62 (3): [PMID:30624936 ] [10.1021/acs.jmedchem.8b01733 ]