The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4beta-N-(8''-aminoquinoline)-4-desoxy-podophyllotoxin ID: ALA4476548
PubChem CID: 155538287
Max Phase: Preclinical
Molecular Formula: C31H28N2O7
Molecular Weight: 540.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@@H]2c3cc4c(cc3[C@@H](Nc3cccc5cccnc35)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC
Standard InChI: InChI=1S/C31H28N2O7/c1-35-24-10-17(11-25(36-2)30(24)37-3)26-18-12-22-23(40-15-39-22)13-19(18)29(20-14-38-31(34)27(20)26)33-21-8-4-6-16-7-5-9-32-28(16)21/h4-13,20,26-27,29,33H,14-15H2,1-3H3/t20-,26+,27-,29+/m0/s1
Standard InChI Key: SZQONOKRTGRBEI-SLFPAOIGSA-N
Molfile:
RDKit 2D
42 48 0 0 0 0 0 0 0 0999 V2000
32.6461 -6.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6443 -5.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3529 -5.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3518 -6.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0618 -6.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0642 -5.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9381 -6.2427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9393 -5.4216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1588 -5.1667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6751 -5.8303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1568 -6.4952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7789 -5.4216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7756 -6.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5576 -6.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0443 -5.8383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5629 -5.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0643 -4.1885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0609 -7.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3535 -7.8787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3522 -8.6951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0599 -9.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7705 -8.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7683 -7.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4791 -9.1002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4810 -9.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0600 -9.9226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3524 -10.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6438 -9.1025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9368 -8.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8070 -7.2807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7678 -7.0617 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
34.7719 -4.6019 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
34.7720 -3.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4761 -4.1898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1834 -3.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1839 -2.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7632 -2.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4714 -2.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4677 -1.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7567 -1.3359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0478 -1.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0550 -2.5689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7 1 1 0
1 4 2 0
3 2 2 0
2 8 1 0
3 4 1 0
3 6 1 0
4 5 1 0
5 13 1 0
12 6 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
6 17 1 1
5 18 1 6
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
21 26 1 0
26 27 1 0
20 28 1 0
28 29 1 0
14 30 2 0
13 31 1 1
12 32 1 6
17 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 38 1 0
37 33 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.57Molecular Weight (Monoisotopic): 540.1897AlogP: 5.08#Rotatable Bonds: 6Polar Surface Area: 97.37Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.78CX LogP: 3.75CX LogD: 3.74Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.34Np Likeness Score: 0.73
References 1. Zhao W, He L, Xiang TL, Tang YJ.. (2019) Discover 4β-NH-(6-aminoindole)-4-desoxy-podophyllotoxin with nanomolar-potency antitumor activity by improving the tubulin binding affinity on the basis of a potential binding site nearby colchicine domain., 170 [PMID:30878833 ] [10.1016/j.ejmech.2019.03.006 ]