6-(3-(2-((2,3-dihydro-1H-inden-2-yl)amino)-7,8-dihydropyrido[4,3-d]pyrimidin-6(5H)-yl)-3-oxopropyl)benzo[d]oxazol-2(3H)-one

ID: ALA4476558

PubChem CID: 155538462

Max Phase: Preclinical

Molecular Formula: C26H25N5O3

Molecular Weight: 455.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCc1ccc2[nH]c(=O)oc2c1)N1CCc2nc(NC3Cc4ccccc4C3)ncc2C1

Standard InChI:  InChI=1S/C26H25N5O3/c32-24(8-6-16-5-7-22-23(11-16)34-26(33)30-22)31-10-9-21-19(15-31)14-27-25(29-21)28-20-12-17-3-1-2-4-18(17)13-20/h1-5,7,11,14,20H,6,8-10,12-13,15H2,(H,30,33)(H,27,28,29)

Standard InChI Key:  RXQRKTRNQXXVJE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   39.8737   -9.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6074   -9.8005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9913   -8.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7951   -8.4904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1765   -9.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9927   -9.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4285   -8.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0421   -7.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2271   -7.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1508   -9.8215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.4594   -9.3859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4958   -8.5688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.8052   -8.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7435   -9.7670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0522   -9.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0800   -8.5169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3891   -8.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6660   -8.4690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.6383   -9.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3335   -9.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9732   -8.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2515   -8.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5587   -7.9857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8370   -8.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1456   -7.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0929   -9.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8112   -9.1858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3951   -9.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4203   -8.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6501   -8.0428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1488   -8.6898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6093   -9.3664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3320   -8.6646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0020   -7.2190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  5  1  0
  4  3  1  0
  3  1  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 16  2  0
 15 14  2  0
 14 11  1  0
 15 16  1  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 29  2  0
 28 26  2  0
 26 27  1  0
 27 24  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
 31 33  2  0
 21 34  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4476558

    ---

Associated Targets(Human)

ENPP2 Tchem Autotaxin (2645 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.52Molecular Weight (Monoisotopic): 455.1957AlogP: 3.01#Rotatable Bonds: 5
Polar Surface Area: 104.12Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.48CX Basic pKa: 2.77CX LogP: 3.19CX LogD: 3.19
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: -1.07

References

1. Jones SB, Pfeifer LA, Bleisch TJ, Beauchamp TJ, Durbin JD, Klimkowski VJ, Hughes NE, Rito CJ, Dao Y, Gruber JM, Bui H, Chambers MG, Chandrasekhar S, Lin C, McCann DJ, Mudra DR, Oskins JL, Swearingen CA, Thirunavukkarasu K, Norman BH..  (2016)  Novel Autotaxin Inhibitors for the Treatment of Osteoarthritis Pain: Lead Optimization via Structure-Based Drug Design.,  (9): [PMID:27660691] [10.1021/acsmedchemlett.6b00207]

Source