The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-1-(4-(4-(1-(3-(1,1-difluoro-2-hydroxyethyl)phenyl)ethylamino)-7-methoxy-2-methylquinazolin-6-yl)-5,6-dihydropyridin-1(2H)-yl)ethanone ID: ALA4476562
PubChem CID: 155538465
Max Phase: Preclinical
Molecular Formula: C27H30F2N4O3
Molecular Weight: 496.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nc(C)nc(N[C@H](C)c3cccc(C(F)(F)CO)c3)c2cc1C1=CCN(C(C)=O)CC1
Standard InChI: InChI=1S/C27H30F2N4O3/c1-16(20-6-5-7-21(12-20)27(28,29)15-34)30-26-23-13-22(19-8-10-33(11-9-19)18(3)35)25(36-4)14-24(23)31-17(2)32-26/h5-8,12-14,16,34H,9-11,15H2,1-4H3,(H,30,31,32)/t16-/m1/s1
Standard InChI Key: BEEKEUHIOTVZFH-MRXNPFEDSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
5.9308 -2.8519 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3436 -3.5618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7520 -2.8494 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.3342 -6.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1940 -6.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7711 -7.7057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0558 -3.9767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2085 -8.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4930 -7.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0547 -6.4636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7640 -6.4607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9222 -8.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4926 -3.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3409 -7.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7720 -6.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6326 -8.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0502 -6.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4924 -8.9439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7706 -8.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7704 -3.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0532 -8.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0547 -4.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2089 -7.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7722 -5.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9190 -7.2871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0520 -7.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4932 -6.4639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4954 -4.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4816 -6.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6290 -7.6988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7618 -7.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4837 -5.2346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3409 -8.9352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3422 -9.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6365 -3.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9296 -3.5617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
6 19 1 0
23 9 1 0
11 29 1 0
7 2 1 0
7 22 2 0
16 30 2 0
19 18 2 0
17 4 1 0
8 12 2 0
24 28 2 0
29 5 1 0
18 8 1 0
25 23 2 0
26 31 1 0
14 26 2 0
12 16 1 0
27 9 1 0
28 13 1 0
31 11 1 0
9 6 2 0
14 30 1 0
30 25 1 0
22 24 1 0
15 27 1 0
14 4 1 0
11 17 1 0
23 8 1 0
13 20 2 0
24 15 1 0
19 21 1 0
20 7 1 0
15 10 1 6
29 32 2 0
16 33 1 0
33 34 1 0
2 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.56Molecular Weight (Monoisotopic): 496.2286AlogP: 4.84#Rotatable Bonds: 7Polar Surface Area: 87.58Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.69CX Basic pKa: 6.29CX LogP: 3.90CX LogD: 3.87Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.49Np Likeness Score: -0.87
References 1. (2018) Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors,