(R)-1-(4-(4-(1-(3-(1,1-difluoro-2-hydroxyethyl)phenyl)ethylamino)-7-methoxy-2-methylquinazolin-6-yl)-5,6-dihydropyridin-1(2H)-yl)ethanone

ID: ALA4476562

PubChem CID: 155538465

Max Phase: Preclinical

Molecular Formula: C27H30F2N4O3

Molecular Weight: 496.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2nc(C)nc(N[C@H](C)c3cccc(C(F)(F)CO)c3)c2cc1C1=CCN(C(C)=O)CC1

Standard InChI:  InChI=1S/C27H30F2N4O3/c1-16(20-6-5-7-21(12-20)27(28,29)15-34)30-26-23-13-22(19-8-10-33(11-9-19)18(3)35)25(36-4)14-24(23)31-17(2)32-26/h5-8,12-14,16,34H,9-11,15H2,1-4H3,(H,30,31,32)/t16-/m1/s1

Standard InChI Key:  BEEKEUHIOTVZFH-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    5.9308   -2.8519    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.3436   -3.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7520   -2.8494    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.3342   -6.4602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1940   -6.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7711   -7.7057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0558   -3.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2085   -8.5294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4930   -7.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0547   -6.4636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7640   -6.4607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9222   -8.9366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4926   -3.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3409   -7.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7720   -6.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6326   -8.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0502   -6.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4924   -8.9439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7706   -8.5330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7704   -3.5665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0532   -8.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0547   -4.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2089   -7.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7722   -5.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9190   -7.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0520   -7.6972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4932   -6.4639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4954   -4.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4816   -6.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6290   -7.6988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7618   -7.2850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4837   -5.2346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3409   -8.9352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3422   -9.7524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6365   -3.9717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9296   -3.5617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  6 19  1  0
 23  9  1  0
 11 29  1  0
  7  2  1  0
  7 22  2  0
 16 30  2  0
 19 18  2  0
 17  4  1  0
  8 12  2  0
 24 28  2  0
 29  5  1  0
 18  8  1  0
 25 23  2  0
 26 31  1  0
 14 26  2  0
 12 16  1  0
 27  9  1  0
 28 13  1  0
 31 11  1  0
  9  6  2  0
 14 30  1  0
 30 25  1  0
 22 24  1  0
 15 27  1  0
 14  4  1  0
 11 17  1  0
 23  8  1  0
 13 20  2  0
 24 15  1  0
 19 21  1  0
 20  7  1  0
 15 10  1  6
 29 32  2  0
 16 33  1  0
 33 34  1  0
  2 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476562

    ---

Associated Targets(Human)

SOS1 Tchem Son of sevenless homolog 1 (1023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.56Molecular Weight (Monoisotopic): 496.2286AlogP: 4.84#Rotatable Bonds: 7
Polar Surface Area: 87.58Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.69CX Basic pKa: 6.29CX LogP: 3.90CX LogD: 3.87
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.49Np Likeness Score: -0.87

References

1.  (2018)  Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors, 

Source