(-)-Lychnopholide

ID: ALA4476580

Cas Number: 77448-64-7

PubChem CID: 49767028

Max Phase: Preclinical

Molecular Formula: C20H22O6

Molecular Weight: 358.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(=O)O[C@@H]2/C=C(/C)C3=CC(=O)[C@@](C)(C[C@H](OC(=O)/C(C)=C\C)[C@@H]12)O3

Standard InChI:  InChI=1S/C20H22O6/c1-6-10(2)18(22)25-15-9-20(5)16(21)8-13(26-20)11(3)7-14-17(15)12(4)19(23)24-14/h6-8,14-15,17H,4,9H2,1-3,5H3/b10-6-,11-7-/t14-,15+,17+,20-/m1/s1

Standard InChI Key:  QATUWZPYBIHFFR-UVXIKMMUSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   11.8369  -15.0478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4999  -14.5699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2455  -13.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4283  -13.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1739  -14.5699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8245  -12.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8245  -13.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8493  -13.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8493  -12.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8823  -12.0804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5453  -11.6025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2909  -10.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4737  -10.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2193  -11.6025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1365  -11.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2484  -11.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7710  -10.1603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5291  -13.6157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2370  -13.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9445  -13.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2376  -12.3904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9439  -14.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6525  -13.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2767  -14.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8369  -15.8650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6111  -13.7891    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0627  -13.7891    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.6530  -12.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
  2  3  1  0
  1  2  1  0
  3  4  1  0
  5  1  1  0
  6  7  1  0
  7  3  1  0
  4  8  1  0
  8  9  2  0
 13 14  2  0
 11 12  1  0
 10 11  1  0
 12 13  1  0
 14 10  1  0
  9 14  1  0
  6 11  1  0
  9 15  1  0
 11 16  1  6
 12 17  2  0
  7 18  1  6
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 20 23  2  0
  2 24  2  0
  1 25  2  0
  4 26  1  1
  3 27  1  6
 23 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476580

    Lychnopholide

Associated Targets(Human)

HT-29 (80576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SNB-19 (46794 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 358.39Molecular Weight (Monoisotopic): 358.1416AlogP: 2.55#Rotatable Bonds: 2
Polar Surface Area: 78.90Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.07CX LogD: 3.07
Aromatic Rings: Heavy Atoms: 26QED Weighted: 0.56Np Likeness Score: 3.37

References

1. Ren Y, de Blanco EJC, Fuchs JR, Soejarto DD, Burdette JE, Swanson SM, Kinghorn AD..  (2019)  Potential Anticancer Agents Characterized from Selected Tropical Plants.,  82  (3): [PMID:30830783] [10.1021/acs.jnatprod.9b00018]

Source