The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(-)-Lychnopholide ID: ALA4476580
Cas Number: 77448-64-7
PubChem CID: 49767028
Max Phase: Preclinical
Molecular Formula: C20H22O6
Molecular Weight: 358.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)O[C@@H]2/C=C(/C)C3=CC(=O)[C@@](C)(C[C@H](OC(=O)/C(C)=C\C)[C@@H]12)O3
Standard InChI: InChI=1S/C20H22O6/c1-6-10(2)18(22)25-15-9-20(5)16(21)8-13(26-20)11(3)7-14-17(15)12(4)19(23)24-14/h6-8,14-15,17H,4,9H2,1-3,5H3/b10-6-,11-7-/t14-,15+,17+,20-/m1/s1
Standard InChI Key: QATUWZPYBIHFFR-UVXIKMMUSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
11.8369 -15.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4999 -14.5699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2455 -13.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4283 -13.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1739 -14.5699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8245 -12.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8245 -13.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8493 -13.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8493 -12.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8823 -12.0804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5453 -11.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2909 -10.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4737 -10.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2193 -11.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1365 -11.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2484 -11.1889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7710 -10.1603 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5291 -13.6157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2370 -13.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9445 -13.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2376 -12.3904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9439 -14.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6525 -13.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2767 -14.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8369 -15.8650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6111 -13.7891 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.0627 -13.7891 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.6530 -12.3914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
2 3 1 0
1 2 1 0
3 4 1 0
5 1 1 0
6 7 1 0
7 3 1 0
4 8 1 0
8 9 2 0
13 14 2 0
11 12 1 0
10 11 1 0
12 13 1 0
14 10 1 0
9 14 1 0
6 11 1 0
9 15 1 0
11 16 1 6
12 17 2 0
7 18 1 6
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
20 23 2 0
2 24 2 0
1 25 2 0
4 26 1 1
3 27 1 6
23 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 358.39Molecular Weight (Monoisotopic): 358.1416AlogP: 2.55#Rotatable Bonds: 2Polar Surface Area: 78.90Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.07CX LogD: 3.07Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.56Np Likeness Score: 3.37
References 1. Ren Y, de Blanco EJC, Fuchs JR, Soejarto DD, Burdette JE, Swanson SM, Kinghorn AD.. (2019) Potential Anticancer Agents Characterized from Selected Tropical Plants., 82 (3): [PMID:30830783 ] [10.1021/acs.jnatprod.9b00018 ]