N-(4-(4-(2-trifluoromethylphenyl)piperazin-1-yl)butyl)-4-(thiophen-3-yl)benzamide

ID: ALA4476605

PubChem CID: 155538429

Max Phase: Preclinical

Molecular Formula: C26H28F3N3OS

Molecular Weight: 487.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCCCCN1CCN(c2ccccc2C(F)(F)F)CC1)c1ccc(-c2ccsc2)cc1

Standard InChI:  InChI=1S/C26H28F3N3OS/c27-26(28,29)23-5-1-2-6-24(23)32-16-14-31(15-17-32)13-4-3-12-30-25(33)21-9-7-20(8-10-21)22-11-18-34-19-22/h1-2,5-11,18-19H,3-4,12-17H2,(H,30,33)

Standard InChI Key:  RSQYYIMQKSBFSO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   20.4834   -3.2646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4834   -4.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1887   -4.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8940   -4.0818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8940   -3.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1887   -2.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7745   -2.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7759   -2.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0678   -1.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3603   -2.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3654   -2.8676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0740   -3.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6011   -4.4915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3094   -4.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0165   -4.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7248   -4.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4319   -4.4956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1402   -4.0880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8474   -4.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1414   -3.2708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8437   -5.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5500   -5.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2592   -5.3147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2578   -4.4933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5509   -4.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9700   -5.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0554   -6.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8547   -6.7035    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.2634   -5.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7166   -5.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4834   -1.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1913   -2.0413    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.4831   -0.8158    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.1851   -1.2175    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 19  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 26  1  0
 23 26  1  0
  8 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476605

    ---

Associated Targets(Human)

DRD3 Tclin Dopamine D3 receptor (14368 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DRD2 Tclin Dopamine D2 receptor (23596 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.59Molecular Weight (Monoisotopic): 487.1905AlogP: 5.77#Rotatable Bonds: 8
Polar Surface Area: 35.58Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.03CX LogP: 5.69CX LogD: 4.96
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -1.83

References

1. Chen PJ, Taylor M, Griffin SA, Amani A, Hayatshahi H, Korzekwa K, Ye M, Mach RH, Liu J, Luedtke RR, Gordon JC, Blass BE..  (2019)  Design, synthesis, and evaluation of N-(4-(4-phenyl piperazin-1-yl)butyl)-4-(thiophen-3-yl)benzamides as selective dopamine D3 receptor ligands.,  29  (18): [PMID:31387791] [10.1016/j.bmcl.2019.07.020]

Source