The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl)benzamido)-4-methoxy benzoic acid ID: ALA4476613
PubChem CID: 139207788
Max Phase: Preclinical
Molecular Formula: C22H19N5O5
Molecular Weight: 433.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)O)c(NC(=O)c2ccc(Cc3c[nH]c4nc(N)[nH]c(=O)c34)cc2)c1
Standard InChI: InChI=1S/C22H19N5O5/c1-32-14-6-7-15(21(30)31)16(9-14)25-19(28)12-4-2-11(3-5-12)8-13-10-24-18-17(13)20(29)27-22(23)26-18/h2-7,9-10H,8H2,1H3,(H,25,28)(H,30,31)(H4,23,24,26,27,29)
Standard InChI Key: IXAPCYKVLYGBPQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
14.8291 -18.9935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8291 -19.8107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5344 -20.2152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5344 -18.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2397 -18.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2442 -19.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0194 -20.0544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4941 -19.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0122 -18.7379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5344 -17.7636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1220 -20.2203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2604 -17.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0588 -17.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6055 -18.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4032 -18.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6521 -17.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0972 -16.8341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3015 -17.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4503 -17.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0012 -17.8679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6975 -16.4855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4956 -16.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0422 -16.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8397 -16.7396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0876 -15.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5318 -15.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7364 -15.5331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1819 -14.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4250 -14.1522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3847 -15.1121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3908 -17.3440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1432 -18.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 2 0
2 11 1 0
9 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
28 29 1 0
28 30 2 0
27 28 1 0
24 31 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.42Molecular Weight (Monoisotopic): 433.1386AlogP: 2.38#Rotatable Bonds: 6Polar Surface Area: 163.19Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.86CX Basic pKa: 1.97CX LogP: 2.91CX LogD: -0.24Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -0.54
References 1. Czyzyk DJ, Valhondo M, Deiana L, Tirado-Rives J, Jorgensen WL, Anderson KS.. (2019) Structure activity relationship towards design of cryptosporidium specific thymidylate synthase inhibitors., 183 [PMID:31536894 ] [10.1016/j.ejmech.2019.111673 ]