The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-(allyloxy)-4-(3-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-enylamino)phenyl)-N-(3,4,5-trimethoxyphenyl)acrylamide ID: ALA4476636
PubChem CID: 155538585
Max Phase: Preclinical
Molecular Formula: C31H31N3O9
Molecular Weight: 589.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCOc1cc(/C=C/C(=O)Nc2cc(OC)c(OC)c(OC)c2)ccc1N/C=C\C(=O)c1ccc(OC)c([N+](=O)[O-])c1
Standard InChI: InChI=1S/C31H31N3O9/c1-6-15-43-27-16-20(8-12-30(36)33-22-18-28(40-3)31(42-5)29(19-22)41-4)7-10-23(27)32-14-13-25(35)21-9-11-26(39-2)24(17-21)34(37)38/h6-14,16-19,32H,1,15H2,2-5H3,(H,33,36)/b12-8+,14-13-
Standard InChI Key: FPDMPUTVPZCIJE-JUDANRDHSA-N
Molfile:
RDKit 2D
43 45 0 0 0 0 0 0 0 0999 V2000
12.5866 -21.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5855 -22.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2935 -22.5085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0032 -22.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0004 -21.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2917 -20.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8775 -22.5075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1701 -22.0984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7065 -20.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4158 -21.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7034 -20.0479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1219 -20.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1189 -20.0426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8250 -19.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5307 -20.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2364 -19.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2337 -18.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5195 -18.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8168 -18.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5310 -20.8584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8234 -21.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8238 -22.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1162 -22.4933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9393 -18.4003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6491 -18.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3547 -18.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0645 -18.7981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3506 -17.5759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7701 -18.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4772 -18.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1823 -18.3798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1786 -17.5618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4638 -17.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7616 -17.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4568 -16.3398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1609 -15.9251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8837 -17.1486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5940 -17.5527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8919 -18.7852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8957 -19.6023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2954 -23.3302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0030 -23.7390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5876 -23.7386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
5 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
15 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
17 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
33 35 1 0
35 36 1 0
32 37 1 0
37 38 1 0
31 39 1 0
39 40 1 0
41 42 2 0
41 43 1 0
3 41 1 0
M CHG 2 41 1 43 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 589.60Molecular Weight (Monoisotopic): 589.2060AlogP: 5.65#Rotatable Bonds: 15Polar Surface Area: 147.49Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.61CX LogD: 4.61Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.07Np Likeness Score: -0.86
References 1. Gaikwad N, Nanduri S, Madhavi YV.. (2019) Cinnamamide: An insight into the pharmacological advances and structure-activity relationships., 181 [PMID:31376564 ] [10.1016/j.ejmech.2019.07.064 ]