The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-(morpholinomethyl)-3-(trifluoromethyl)phenyl)-3-((3-(2-(pyridin-2-yl)vinyl)-1H-indazol-6-yl)thio)propanamide ID: ALA4476651
PubChem CID: 141763974
Max Phase: Preclinical
Molecular Formula: C29H28F3N5O2S
Molecular Weight: 567.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCSc1ccc2c(/C=C/c3ccccn3)n[nH]c2c1)Nc1ccc(CN2CCOCC2)c(C(F)(F)F)c1
Standard InChI: InChI=1S/C29H28F3N5O2S/c30-29(31,32)25-17-22(5-4-20(25)19-37-12-14-39-15-13-37)34-28(38)10-16-40-23-7-8-24-26(35-36-27(24)18-23)9-6-21-3-1-2-11-33-21/h1-9,11,17-18H,10,12-16,19H2,(H,34,38)(H,35,36)/b9-6+
Standard InChI Key: BKXWZGWGMMKUNW-RMKNXTFCSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
6.2318 -10.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9415 -9.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9387 -9.0886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2301 -8.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5238 -9.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5205 -9.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7429 -8.8461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2656 -9.5086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7483 -10.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6448 -8.6774 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.3541 -9.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0602 -8.6721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7695 -9.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4757 -8.6667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7726 -9.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4989 -10.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7003 -11.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4509 -11.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6525 -12.0665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4031 -12.8439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9526 -13.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7548 -13.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0005 -12.4961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1849 -9.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1851 -9.8899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8935 -10.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6007 -9.8844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5949 -9.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8860 -8.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3104 -10.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8979 -11.1156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9003 -11.8592 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.2377 -11.6574 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.5616 -11.6530 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.0161 -9.8772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7227 -10.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4262 -9.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4263 -9.0616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7167 -8.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0070 -9.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
3 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
9 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
14 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
31 32 1 0
31 33 1 0
31 34 1 0
26 31 1 0
30 35 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 567.64Molecular Weight (Monoisotopic): 567.1916AlogP: 6.10#Rotatable Bonds: 9Polar Surface Area: 83.14Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.40CX Basic pKa: 5.60CX LogP: 5.16CX LogD: 5.15Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -1.91
References 1. Liu X, Wang B, Chen C, Jiang Z, Hu C, Wu H, Zhang Y, Liu X, Wang W, Wang J, Hu Z, Wang A, Huang T, Liu Q, Wang W, Wang L, Wang W, Ren T, Li L, Xia R, Ge J, Liu Q, Liu J.. (2018) Discovery of (E)-N-(4-((4-methylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)-3-((3-(2-(pyridin-2-yl)vinyl)-1H-indazol-6-yl)thio)propanamide (CHMFL-ABL-121) as a highly potent ABL kinase inhibitor capable of overcoming a variety of ABL mutants including T315I for chronic myeloid leukemia., 160 [PMID:30317026 ] [10.1016/j.ejmech.2018.10.007 ]