The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,2'-(biphenyl-3,4'-diylbis(methan-1-yl-1-ylidene))bis(1-(4-chlorophenyl)hydrazine) ID: ALA4476657
PubChem CID: 137394492
Max Phase: Preclinical
Molecular Formula: C26H20Cl2N4
Molecular Weight: 459.38
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Clc1ccc(N/N=C/c2ccc(-c3cccc(/C=N/Nc4ccc(Cl)cc4)c3)cc2)cc1
Standard InChI: InChI=1S/C26H20Cl2N4/c27-23-8-12-25(13-9-23)31-29-17-19-4-6-21(7-5-19)22-3-1-2-20(16-22)18-30-32-26-14-10-24(28)11-15-26/h1-18,31-32H/b29-17+,30-18+
Standard InChI Key: ZWSDNKYGHQQSPL-YAGSLNJISA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
34.3660 -11.3540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3649 -12.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0729 -12.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7826 -12.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7797 -11.3504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0711 -10.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4829 -10.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1924 -11.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8981 -10.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8955 -10.1194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1812 -9.7137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4785 -10.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6568 -12.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9495 -12.1724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2414 -12.5804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6071 -11.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3135 -10.9328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0226 -11.3391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7289 -10.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5340 -12.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5394 -11.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8329 -10.9440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1239 -11.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1259 -12.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8330 -12.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4339 -11.3369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1398 -10.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1375 -10.1086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4235 -9.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7205 -10.1151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4160 -10.9439 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
42.8433 -9.6968 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
2 13 1 0
13 14 2 0
14 15 1 0
9 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
15 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
19 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 19 1 0
23 31 1 0
28 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.38Molecular Weight (Monoisotopic): 458.1065AlogP: 7.55#Rotatable Bonds: 7Polar Surface Area: 48.78Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.25CX LogP: 8.48CX LogD: 8.48Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.22Np Likeness Score: -0.99
References 1. Thamban Chandrika N, Dennis EK, Shrestha SK, Ngo HX, Green KD, Kwiatkowski S, Deaciuc AG, Dwoskin LP, Watt DS, Garneau-Tsodikova S.. (2019) N,N'-diaryl-bishydrazones in a biphenyl platform: Broad spectrum antifungal agents., 164 [PMID:30597328 ] [10.1016/j.ejmech.2018.12.042 ]