The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Euphorhelipane A ID: ALA4476668
PubChem CID: 155538543
Max Phase: Preclinical
Molecular Formula: C20H30O4
Molecular Weight: 334.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)C(C)(C)/C=C/[C@@H](C)[C@@]1(O)C(=O)[C@H]2[C@@H](C=C[C@@H]2C)[C@H](C)[C@@H]1O
Standard InChI: InChI=1S/C20H30O4/c1-11-7-8-15-13(3)17(22)20(24,18(23)16(11)15)12(2)9-10-19(5,6)14(4)21/h7-13,15-17,22,24H,1-6H3/b10-9+/t11-,12+,13-,15-,16+,17-,20-/m0/s1
Standard InChI Key: VBBUAGFTVXZMSN-PTVWPMOQSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
7.0782 -8.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8995 -8.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4868 -7.9636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7611 -12.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4705 -11.9566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4705 -11.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7611 -10.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0517 -11.9566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0472 -11.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2646 -10.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7837 -11.5508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2718 -12.2133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1836 -10.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8901 -11.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1860 -9.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8990 -9.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6103 -8.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6127 -7.4435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3209 -8.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7611 -13.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1818 -12.3662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0476 -12.7779 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.0393 -10.3139 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.0078 -10.1071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7622 -9.8971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1773 -11.5439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
9 7 1 0
8 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
6 13 1 0
13 14 1 1
13 15 1 0
15 16 2 0
16 2 1 0
2 17 1 0
17 18 2 0
17 19 1 0
4 20 1 1
5 21 1 1
8 22 1 1
9 23 1 6
10 24 1 6
7 25 2 0
6 26 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 334.46Molecular Weight (Monoisotopic): 334.2144AlogP: 2.54#Rotatable Bonds: 4Polar Surface Area: 74.60Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.90CX Basic pKa: ┄CX LogP: 3.04CX LogD: 3.04Aromatic Rings: ┄Heavy Atoms: 24QED Weighted: 0.77Np Likeness Score: 1.49
References 1. Li W, Tang YQ, Chen SX, Tang GH, Gan LS, Li C, Rao Y, Huang ZS, Yin S.. (2019) Euphorhelipanes A and B, Triglyceride-Lowering Euphorbia Diterpenoids with a Bicyclo[4.3.0]nonane Core from Euphorbia helioscopia., 82 (2): [PMID:30724086 ] [10.1021/acs.jnatprod.8b00780 ]