The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 2-[((adamantan-1-yl)carbonyl)amino]-5-ethyl-4-methylthiophene-3-carboxylate ID: ALA4476681
PubChem CID: 155538552
Max Phase: Preclinical
Molecular Formula: C20H27NO3S
Molecular Weight: 361.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1sc(NC(=O)C23CC4CC(CC(C4)C2)C3)c(C(=O)OC)c1C
Standard InChI: InChI=1S/C20H27NO3S/c1-4-15-11(2)16(18(22)24-3)17(25-15)21-19(23)20-8-12-5-13(9-20)7-14(6-12)10-20/h12-14H,4-10H2,1-3H3,(H,21,23)
Standard InChI Key: LMFJEFWVETVREV-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 28 0 0 0 0 0 0 0 0999 V2000
8.8010 -8.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1945 -9.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0100 -8.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4756 -9.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2485 -8.5791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7390 -9.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0474 -9.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5239 -10.3735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2316 -10.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7668 -10.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5370 -10.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3583 -10.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6127 -9.7147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9456 -9.2326 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.2869 -9.7147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3200 -9.2986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8379 -11.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5046 -11.9117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6584 -11.1600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0362 -9.6996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0449 -10.5209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9856 -12.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5097 -9.4620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3401 -8.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0553 -11.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 11 2 0
13 16 1 0
12 17 1 0
17 18 1 0
17 19 2 0
16 20 1 0
20 21 2 0
20 6 1 0
18 22 1 0
15 23 1 0
23 24 1 0
11 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 361.51Molecular Weight (Monoisotopic): 361.1712AlogP: 4.56#Rotatable Bonds: 4Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.58CX Basic pKa: ┄CX LogP: 6.02CX LogD: 6.02Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.80Np Likeness Score: -1.09
References 1. Mugnaini C, Rabbito A, Brizzi A, Palombi N, Petrosino S, Verde R, Di Marzo V, Ligresti A, Corelli F.. (2019) Synthesis of novel 2-(1-adamantanylcarboxamido)thiophene derivatives. Selective cannabinoid type 2 (CB2) receptor agonists as potential agents for the treatment of skin inflammatory disease., 161 [PMID:30359820 ] [10.1016/j.ejmech.2018.09.070 ]