(aS)-4,8,4',8'-tetramethoxy-(1,1'-biphenanthrene)-2,7,2',7'-tetrol

ID: ALA4476683

PubChem CID: 155538554

Max Phase: Preclinical

Molecular Formula: C32H26O8

Molecular Weight: 538.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(ccc3c(OC)c(O)ccc32)c1-c1c(OC)cc(O)c2c1ccc1c(OC)c(O)ccc12

Standard InChI:  InChI=1S/C32H26O8/c1-37-25-13-23(35)27-15-9-11-21(33)31(39-3)17(15)5-7-19(27)29(25)30-20-8-6-18-16(10-12-22(34)32(18)40-4)28(20)24(36)14-26(30)38-2/h5-14,33-36H,1-4H3

Standard InChI Key:  DDWHPHCYLJLNDE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
   31.6503   -3.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0710   -4.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0682   -3.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3595   -2.7732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3613   -4.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6492   -4.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9389   -4.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9397   -5.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3638   -5.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6574   -5.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6595   -6.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3672   -6.8649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0703   -6.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0647   -5.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9538   -6.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5319   -7.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2497   -8.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9571   -7.6874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5303   -6.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2390   -6.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2393   -5.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5316   -5.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8254   -6.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8225   -5.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1181   -5.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4202   -5.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4271   -6.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1279   -6.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3571   -1.9519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9384   -2.7736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9382   -1.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1142   -4.4300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8240   -4.0139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7057   -5.2547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8216   -8.1041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6711   -8.0923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6754   -8.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3708   -7.6862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0802   -8.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7742   -5.2239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  5  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8 10  1  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14  9  2  0
 15 20  2  0
 19 16  2  0
 16 17  1  0
 17 18  2  0
 18 15  1  0
 11 15  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 24  1  0
 23 19  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 23  2  0
  4 29  1  0
  1 30  1  0
 30 31  1  0
 25 32  1  0
 32 33  1  0
 26 34  1  0
 16 35  1  0
 18 36  1  0
 36 37  1  0
 12 38  1  0
 38 39  1  0
 14 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476683

    ---

Associated Targets(non-human)

BV-2 (3710 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.55Molecular Weight (Monoisotopic): 538.1628AlogP: 6.82#Rotatable Bonds: 5
Polar Surface Area: 117.84Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.48CX Basic pKa: CX LogP: 5.73CX LogD: 5.70
Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: 0.76

References

1. Zhou D, Chen G, Ma YP, Wang CG, Lin B, Yang YQ, Li W, Koike K, Hou Y, Li N..  (2019)  Isolation, Structural Elucidation, Optical Resolution, and Antineuroinflammatory Activity of Phenanthrene and 9,10-Dihydrophenanthrene Derivatives from Bletilla striata.,  82  (8): [PMID:31415170] [10.1021/acs.jnatprod.9b00291]
2. Zhou D, Chen G, Ma YP, Wang CG, Lin B, Yang YQ, Li W, Koike K, Hou Y, Li N..  (2019)  Isolation, Structural Elucidation, Optical Resolution, and Antineuroinflammatory Activity of Phenanthrene and 9,10-Dihydrophenanthrene Derivatives from Bletilla striata.,  82  (8): [PMID:31415170] [10.1021/acs.jnatprod.9b00291]

Source