The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(aS)-4,8,4',8'-tetramethoxy-(1,1'-biphenanthrene)-2,7,2',7'-tetrol ID: ALA4476683
PubChem CID: 155538554
Max Phase: Preclinical
Molecular Formula: C32H26O8
Molecular Weight: 538.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c2c(ccc3c(OC)c(O)ccc32)c1-c1c(OC)cc(O)c2c1ccc1c(OC)c(O)ccc12
Standard InChI: InChI=1S/C32H26O8/c1-37-25-13-23(35)27-15-9-11-21(33)31(39-3)17(15)5-7-19(27)29(25)30-20-8-6-18-16(10-12-22(34)32(18)40-4)28(20)24(36)14-26(30)38-2/h5-14,33-36H,1-4H3
Standard InChI Key: DDWHPHCYLJLNDE-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
31.6503 -3.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0710 -4.0052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0682 -3.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3595 -2.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3613 -4.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6492 -4.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9389 -4.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9397 -5.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3638 -5.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6574 -5.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6595 -6.4568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3672 -6.8649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0703 -6.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0647 -5.6365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9538 -6.8695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5319 -7.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2497 -8.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9571 -7.6874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5303 -6.8706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2390 -6.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2393 -5.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5316 -5.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8254 -6.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8225 -5.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1181 -5.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4202 -5.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4271 -6.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1279 -6.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3571 -1.9519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9384 -2.7736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9382 -1.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1142 -4.4300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8240 -4.0139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7057 -5.2547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8216 -8.1041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6711 -8.0923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6754 -8.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3708 -7.6862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0802 -8.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7742 -5.2239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 6 2 0
5 2 2 0
2 3 1 0
3 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 10 1 0
9 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 9 2 0
15 20 2 0
19 16 2 0
16 17 1 0
17 18 2 0
18 15 1 0
11 15 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 24 1 0
23 19 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 23 2 0
4 29 1 0
1 30 1 0
30 31 1 0
25 32 1 0
32 33 1 0
26 34 1 0
16 35 1 0
18 36 1 0
36 37 1 0
12 38 1 0
38 39 1 0
14 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.55Molecular Weight (Monoisotopic): 538.1628AlogP: 6.82#Rotatable Bonds: 5Polar Surface Area: 117.84Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.48CX Basic pKa: ┄CX LogP: 5.73CX LogD: 5.70Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: 0.76
References 1. Zhou D, Chen G, Ma YP, Wang CG, Lin B, Yang YQ, Li W, Koike K, Hou Y, Li N.. (2019) Isolation, Structural Elucidation, Optical Resolution, and Antineuroinflammatory Activity of Phenanthrene and 9,10-Dihydrophenanthrene Derivatives from Bletilla striata ., 82 (8): [PMID:31415170 ] [10.1021/acs.jnatprod.9b00291 ] 2. Zhou D, Chen G, Ma YP, Wang CG, Lin B, Yang YQ, Li W, Koike K, Hou Y, Li N.. (2019) Isolation, Structural Elucidation, Optical Resolution, and Antineuroinflammatory Activity of Phenanthrene and 9,10-Dihydrophenanthrene Derivatives from Bletilla striata ., 82 (8): [PMID:31415170 ] [10.1021/acs.jnatprod.9b00291 ]