trans-4-((R)-3-(4-fluorophenylsulfonyl)-3-(4-(perfluoropropan-2-yl)phenyl)pyrrolidine-1-carbonyl)-4-(methoxymethyl)cyclohexanecarboxylic acid

ID: ALA4476687

PubChem CID: 118217871

Max Phase: Preclinical

Molecular Formula: C29H29F8NO6S

Molecular Weight: 671.60

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  COC[C@]1(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC[C@H](C(=O)O)CC1

Standard InChI:  InChI=1S/C29H29F8NO6S/c1-44-17-25(12-10-18(11-13-25)23(39)40)24(41)38-15-14-26(16-38,45(42,43)22-8-6-21(30)7-9-22)19-2-4-20(5-3-19)27(31,28(32,33)34)29(35,36)37/h2-9,18H,10-17H2,1H3,(H,39,40)/t18-,25-,26-/m0/s1

Standard InChI Key:  VTXAHBUSZIDRJU-ATANMQQVSA-N

Molfile:  

 
     RDKit          2D

 45 48  0  0  0  0  0  0  0  0999 V2000
    6.9296  -29.5138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9337  -28.6966    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.2240  -29.1016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5295  -27.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3178  -27.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3573  -26.9590    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5934  -26.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0819  -27.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4862  -28.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3017  -28.6951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7086  -27.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3012  -27.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4827  -27.2873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0794  -27.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2622  -27.9948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8515  -27.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0344  -27.2907    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2580  -26.5794    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.4351  -26.5752    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8558  -28.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0386  -28.7062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2665  -29.4102    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.4392  -29.4065    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.4433  -27.9867    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.7514  -28.6988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1565  -29.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9729  -29.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3825  -28.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9697  -27.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1546  -27.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0409  -26.5113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7705  -26.8794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1997  -28.6988    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.0357  -25.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7444  -25.2791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7412  -24.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0309  -24.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3222  -24.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3238  -25.2892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0288  -23.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7355  -22.8268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3201  -22.8305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7415  -26.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4497  -25.6928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1569  -26.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 16 19  1  0
 15 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
 15 24  1  0
  4 11  1  6
  4  2  1  0
  2 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  6 31  1  0
 31 32  2  0
 28 33  1  0
 34 31  1  1
 34 35  1  0
 34 39  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 37 40  1  6
 40 41  2  0
 40 42  1  0
 34 43  1  0
 43 44  1  0
 44 45  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4476687

   4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-4-(methoxymethyl)cyclohexane-1-carboxylic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 671.60

Molecular Weight (Monoisotopic): 671.1588

AlogP: 5.92

#Rotatable Bonds: 8

Polar Surface Area: 100.98

Molecular Species: ACID

HBA: 5

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 4.09

CX Basic pKa: ┄

CX LogP: 5.53

CX LogD: 2.42

Aromatic Rings: 2

Heavy Atoms: 45

QED Weighted: 0.28

Np Likeness Score: -0.44

References

1. Lu Z, Duan JJ, Xiao H, Neels J, Wu DR, Weigelt CA, Sack JS, Khan J, Ruzanov M, An Y, Yarde M, Karmakar A, Vishwakrishnan S, Baratam V, Shankarappa H, Vanteru S, Babu V, Basha M, Kumar Gupta A, Kumaravel S, Mathur A, Zhao Q, Salter-Cid LM, Carter PH, Murali Dhar TG..  (2019)  Identification of potent, selective and orally bioavailable phenyl ((R)-3-phenylpyrrolidin-3-yl)sulfone analogues as RORγt inverse agonists.,  29  (16): [PMID:31257087] [10.1016/j.bmcl.2019.06.036]

Source

Source(1):

• Scientific Literature