3-Ethyl-1-(4-{4-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl}phenyl)urea

ID: ALA4476698

PubChem CID: 53380858

Max Phase: Preclinical

Molecular Formula: C18H23N5O2

Molecular Weight: 341.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCNC(=O)Nc1ccc(-c2nccc(N3CCOC[C@@H]3C)n2)cc1

Standard InChI:  InChI=1S/C18H23N5O2/c1-3-19-18(24)21-15-6-4-14(5-7-15)17-20-9-8-16(22-17)23-10-11-25-12-13(23)2/h4-9,13H,3,10-12H2,1-2H3,(H2,19,21,24)/t13-/m0/s1

Standard InChI Key:  DEJDYNKIJWOSHA-ZDUSSCGKSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    2.2015  -19.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2004  -20.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9163  -20.7211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6338  -20.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6309  -19.4743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9145  -19.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9104  -18.2471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6265  -17.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6260  -17.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9111  -16.5968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1949  -17.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1938  -17.8366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3464  -20.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3464  -21.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0616  -21.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7775  -21.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7736  -20.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0577  -20.3029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3423  -18.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4896  -21.9523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2003  -21.5404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9124  -21.9500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1990  -20.7189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6230  -21.5381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3351  -21.9477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  6  7  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  4 13  1  0
  8 19  1  6
 16 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 24 25  1  0
M  END

Associated Targets(Human)

PIK3CA Tclin PI3-kinase p110-alpha subunit (12269 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3CD Tclin PI3-kinase p110-delta subunit (6699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 341.42Molecular Weight (Monoisotopic): 341.1852AlogP: 2.51#Rotatable Bonds: 4
Polar Surface Area: 79.38Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.04CX Basic pKa: 5.44CX LogP: 2.99CX LogD: 2.99
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.89Np Likeness Score: -1.89

References

1. Hobbs H, Bravi G, Campbell I, Convery M, Davies H, Inglis G, Pal S, Peace S, Redmond J, Summers D..  (2019)  Discovery of 3-Oxabicyclo[4.1.0]heptane, a Non-nitrogen Containing Morpholine Isostere, and Its Application in Novel Inhibitors of the PI3K-AKT-mTOR Pathway.,  62  (15): [PMID:31283227] [10.1021/acs.jmedchem.9b00348]

Source