Rac-7-(3-Amino-2,3-dihydro-1H-inden-5-yl)-4-methylquinolin-2-amine Dihydrochloride

ID: ALA4476709

PubChem CID: 155538476

Max Phase: Preclinical

Molecular Formula: C19H21Cl2N3

Molecular Weight: 289.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(N)nc2cc(-c3ccc4c(c3)C(N)CC4)ccc12.Cl.Cl

Standard InChI:  InChI=1S/C19H19N3.2ClH/c1-11-8-19(21)22-18-10-14(4-6-15(11)18)13-3-2-12-5-7-17(20)16(12)9-13;;/h2-4,6,8-10,17H,5,7,20H2,1H3,(H2,21,22);2*1H

Standard InChI Key:  KAWHQACYSASIOW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   23.3380  -13.7390    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   22.9300  -11.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9289  -11.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6447  -12.3396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6428  -10.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3593  -11.0929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3600  -11.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0763  -12.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7923  -11.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7876  -11.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0707  -10.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2131  -12.3386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6404   -9.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5016  -12.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5042  -13.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2074  -11.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9190  -12.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9297  -13.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2178  -13.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3942  -14.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2154  -14.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5462  -13.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8485  -14.9712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.2584  -10.1963    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  3 12  1  0
  5 13  1  0
 14 15  2  0
 15 19  1  0
 16 14  1  0
  9 14  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 20 23  1  0
M  END

Associated Targets(non-human)

Nos1 Nitric-oxide synthase, brain (2987 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 289.38Molecular Weight (Monoisotopic): 289.1579AlogP: 3.74#Rotatable Bonds: 1
Polar Surface Area: 64.93Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.49CX LogP: 3.73CX LogD: 1.59
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.72Np Likeness Score: 0.13

References

1. Cinelli MA, Reidl CT, Li H, Chreifi G, Poulos TL, Silverman RB..  (2020)  First Contact: 7-Phenyl-2-Aminoquinolines, Potent and Selective Neuronal Nitric Oxide Synthase Inhibitors That Target an Isoform-Specific Aspartate.,  63  (9): [PMID:32302123] [10.1021/acs.jmedchem.9b01573]

Source