The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(2-Benzyl-4-(4-fluorophenyl)-1H-imidazol-5-yl)pyridin-2-yl)cyclopropanecarboxamide ID: ALA4476724
PubChem CID: 155538620
Max Phase: Preclinical
Molecular Formula: C25H21FN4O
Molecular Weight: 412.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cc(-c2[nH]c(Cc3ccccc3)nc2-c2ccc(F)cc2)ccn1)C1CC1
Standard InChI: InChI=1S/C25H21FN4O/c26-20-10-8-17(9-11-20)23-24(29-22(28-23)14-16-4-2-1-3-5-16)19-12-13-27-21(15-19)30-25(31)18-6-7-18/h1-5,8-13,15,18H,6-7,14H2,(H,28,29)(H,27,30,31)
Standard InChI Key: AFZIRKJTSPMVSW-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
39.7883 -25.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6938 -26.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4365 -26.3815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9902 -25.7803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5895 -25.0681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1893 -24.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3698 -23.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7695 -23.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9885 -23.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8113 -24.3738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4129 -24.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9850 -26.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2817 -26.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5699 -26.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5603 -27.2404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2683 -27.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9772 -27.2545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3867 -23.0189 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.2620 -28.4740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.9666 -28.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9603 -29.7052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6774 -28.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4920 -28.4880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0889 -27.7772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8047 -25.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2147 -26.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8039 -27.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2133 -27.8984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0313 -27.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4383 -27.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0267 -26.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
1 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
2 12 1 0
9 18 1 0
16 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
23 22 1 0
24 23 1 0
22 24 1 0
4 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.47Molecular Weight (Monoisotopic): 412.1699AlogP: 5.22#Rotatable Bonds: 6Polar Surface Area: 70.67Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.90CX Basic pKa: 5.61CX LogP: 4.95CX LogD: 4.94Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -1.38
References 1. Heider F, Ansideri F, Tesch R, Pantsar T, Haun U, Döring E, Kudolo M, Poso A, Albrecht W, Laufer SA, Koch P.. (2019) Pyridinylimidazoles as dual glycogen synthase kinase 3β/p38α mitogen-activated protein kinase inhibitors., 175 [PMID:31096153 ] [10.1016/j.ejmech.2019.04.035 ]