The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Myxochelin B4 ID: ALA4476763
PubChem CID: 155538568
Max Phase: Preclinical
Molecular Formula: C20H25N3O5
Molecular Weight: 387.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC[C@H](CCCCNC(=O)c1ccccc1O)NC(=O)c1cccc(O)c1O
Standard InChI: InChI=1S/C20H25N3O5/c21-12-13(23-20(28)15-8-5-10-17(25)18(15)26)6-3-4-11-22-19(27)14-7-1-2-9-16(14)24/h1-2,5,7-10,13,24-26H,3-4,6,11-12,21H2,(H,22,27)(H,23,28)/t13-/m0/s1
Standard InChI Key: HJKTUTBIUUIOGM-ZDUSSCGKSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
29.1152 -9.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1140 -10.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8289 -11.0819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5453 -10.6685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5424 -9.8380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8271 -9.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2554 -9.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2523 -8.5978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9714 -9.8325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.6843 -9.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4003 -9.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1132 -9.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8292 -9.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5422 -9.4066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2581 -9.8164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9711 -9.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6870 -9.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9679 -8.5763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6878 -10.6344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4029 -11.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1169 -10.6289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1110 -9.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3954 -9.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5390 -8.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8230 -8.1718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8245 -8.6038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3885 -8.5687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.8225 -9.3819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
14 24 1 1
24 25 1 0
6 26 1 0
23 27 1 0
22 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 387.44Molecular Weight (Monoisotopic): 387.1794AlogP: 1.46#Rotatable Bonds: 9Polar Surface Area: 144.91Molecular Species: BASEHBA: 6HBD: 6#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 7#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.92CX Basic pKa: 9.28CX LogP: 1.53CX LogD: 1.23Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.28Np Likeness Score: -0.14
References 1. Sester A, Winand L, Pace S, Hiller W, Werz O, Nett M.. (2019) Myxochelin- and Pseudochelin-Derived Lipoxygenase Inhibitors from a Genetically Engineered Myxococcus xanthus Strain., 82 (9): [PMID:31465225 ] [10.1021/acs.jnatprod.9b00403 ]