The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Monbarbatain A ID: ALA4476765
Cas Number: 138711-55-4
PubChem CID: 85625420
Max Phase: Preclinical
Molecular Formula: C30H22O6
Molecular Weight: 478.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c2c(ccc3cc(O)ccc32)c1-c1c(OC)cc(O)c2c1ccc1cc(O)ccc12
Standard InChI: InChI=1S/C30H22O6/c1-35-25-13-23(33)27-19-9-5-17(31)11-15(19)3-7-21(27)29(25)30-22-8-4-16-12-18(32)6-10-20(16)28(22)24(34)14-26(30)36-2/h3-14,31-34H,1-2H3
Standard InChI Key: RBVCTUJCRSUBKB-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
4.1464 -13.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1453 -14.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5643 -13.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8557 -13.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5671 -14.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8562 -14.8205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2765 -15.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2781 -14.8159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5656 -16.0489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8574 -15.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1438 -16.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1414 -16.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8532 -12.3649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4373 -15.6324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5649 -16.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8557 -17.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8552 -18.0934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2730 -17.2721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2714 -18.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9787 -18.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5634 -18.4947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6847 -18.0810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9716 -16.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6818 -17.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6762 -15.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9656 -16.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3865 -16.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3840 -16.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0876 -17.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7984 -16.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7969 -16.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0885 -15.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4996 -15.6265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3897 -18.4871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1473 -18.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5628 -19.3119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 6 1 0
5 3 1 0
3 4 2 0
4 1 1 0
5 6 2 0
5 8 1 0
6 10 1 0
9 7 1 0
7 8 2 0
9 10 2 0
10 11 1 0
11 12 2 0
12 16 1 0
15 9 1 0
4 13 1 0
11 14 1 0
15 16 2 0
16 17 1 0
15 18 1 0
18 19 2 0
19 20 1 0
20 22 2 0
23 18 1 0
19 21 1 0
24 22 1 0
23 24 2 0
23 26 1 0
24 28 1 0
27 25 1 0
25 26 2 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
31 33 1 0
22 34 1 0
17 35 1 0
21 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.50Molecular Weight (Monoisotopic): 478.1416AlogP: 6.81#Rotatable Bonds: 3Polar Surface Area: 99.38Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.50CX Basic pKa: ┄CX LogP: 6.05CX LogD: 6.01Aromatic Rings: 6Heavy Atoms: 36QED Weighted: 0.21Np Likeness Score: 0.73
References 1. Zhou D, Chen G, Ma YP, Wang CG, Lin B, Yang YQ, Li W, Koike K, Hou Y, Li N.. (2019) Isolation, Structural Elucidation, Optical Resolution, and Antineuroinflammatory Activity of Phenanthrene and 9,10-Dihydrophenanthrene Derivatives from Bletilla striata ., 82 (8): [PMID:31415170 ] [10.1021/acs.jnatprod.9b00291 ] 2. Tóth B, Hohmann J, Vasas A.. (2018) Phenanthrenes: A Promising Group of Plant Secondary Metabolites., 81 (3.0): [PMID:29280630 ] [10.1021/acs.jnatprod.7b00619 ]