Monbarbatain A

ID: ALA4476765

Cas Number: 138711-55-4

PubChem CID: 85625420

Max Phase: Preclinical

Molecular Formula: C30H22O6

Molecular Weight: 478.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(ccc3cc(O)ccc32)c1-c1c(OC)cc(O)c2c1ccc1cc(O)ccc12

Standard InChI:  InChI=1S/C30H22O6/c1-35-25-13-23(33)27-19-9-5-17(31)11-15(19)3-7-21(27)29(25)30-22-8-4-16-12-18(32)6-10-20(16)28(22)24(34)14-26(30)36-2/h3-14,31-34H,1-2H3

Standard InChI Key:  RBVCTUJCRSUBKB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    4.1464  -13.5909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1453  -14.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5643  -13.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8557  -13.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5671  -14.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8562  -14.8205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2765  -15.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2781  -14.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5656  -16.0489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8574  -15.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1438  -16.0431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1414  -16.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8532  -12.3649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4373  -15.6324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5649  -16.8641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8557  -17.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8552  -18.0934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2730  -17.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2714  -18.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9787  -18.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5634  -18.4947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6847  -18.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9716  -16.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6818  -17.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6762  -15.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9656  -16.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3865  -16.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3840  -16.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0876  -17.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7984  -16.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7969  -16.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0885  -15.6300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4996  -15.6265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3897  -18.4871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1473  -18.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5628  -19.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  2  0
  5  8  1  0
  6 10  1  0
  9  7  1  0
  7  8  2  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 16  1  0
 15  9  1  0
  4 13  1  0
 11 14  1  0
 15 16  2  0
 16 17  1  0
 15 18  1  0
 18 19  2  0
 19 20  1  0
 20 22  2  0
 23 18  1  0
 19 21  1  0
 24 22  1  0
 23 24  2  0
 23 26  1  0
 24 28  1  0
 27 25  1  0
 25 26  2  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 31 33  1  0
 22 34  1  0
 17 35  1  0
 21 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476765

    Monbarbatain A

Associated Targets(non-human)

BV-2 (3710 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 478.50Molecular Weight (Monoisotopic): 478.1416AlogP: 6.81#Rotatable Bonds: 3
Polar Surface Area: 99.38Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.50CX Basic pKa: CX LogP: 6.05CX LogD: 6.01
Aromatic Rings: 6Heavy Atoms: 36QED Weighted: 0.21Np Likeness Score: 0.73

References

1. Zhou D, Chen G, Ma YP, Wang CG, Lin B, Yang YQ, Li W, Koike K, Hou Y, Li N..  (2019)  Isolation, Structural Elucidation, Optical Resolution, and Antineuroinflammatory Activity of Phenanthrene and 9,10-Dihydrophenanthrene Derivatives from Bletilla striata.,  82  (8): [PMID:31415170] [10.1021/acs.jnatprod.9b00291]
2. Tóth B, Hohmann J, Vasas A..  (2018)  Phenanthrenes: A Promising Group of Plant Secondary Metabolites.,  81  (3.0): [PMID:29280630] [10.1021/acs.jnatprod.7b00619]

Source