(2S)-isopropyl 2-((4-chlorophenoxy)(((2S,3S,4R,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-2-fluoro-3,4-dihydroxy-4-methyltetrahydrofuran-2-yl)methoxy)phosphorylamino)propanoate

ID: ALA4476774

PubChem CID: 90247955

Max Phase: Preclinical

Molecular Formula: C22H28ClFN3O10P

Molecular Weight: 579.90

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@@]1(F)O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O)Oc1ccc(Cl)cc1

Standard InChI:  InChI=1S/C22H28ClFN3O10P/c1-12(2)35-17(29)13(3)26-38(33,37-15-7-5-14(23)6-8-15)34-11-22(24)18(30)21(4,32)19(36-22)27-10-9-16(28)25-20(27)31/h5-10,12-13,18-19,30,32H,11H2,1-4H3,(H,26,33)(H,25,28,31)/t13-,18-,19+,21+,22+,38?/m0/s1

Standard InChI Key:  ZIKSMXHRIKVGDU-MPRLAMPNSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   25.5971  -24.9367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0098  -25.6466    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   26.4182  -24.9342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4172  -27.2892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7120  -26.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2992  -28.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4820  -28.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6689  -28.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7405  -27.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0775  -26.8105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4532  -26.8912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1527  -27.3078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8627  -26.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8760  -26.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1730  -25.6745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4568  -26.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7531  -25.6578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5896  -25.6949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2521  -28.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7166  -26.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2999  -26.0511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7799  -24.9392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1485  -24.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5637  -25.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3787  -25.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2952  -26.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5852  -27.2728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0006  -27.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8799  -26.8602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.5806  -28.0900    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8705  -28.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8659  -29.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1652  -28.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8865  -28.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7073  -27.6937    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.5558  -24.2347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3689  -24.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3314  -24.9477    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  8  7  1  0
  7  9  1  0
  9 10  1  0
 10  4  1  0
  4  8  1  0
  9 11  1  1
 11 12  1  0
 11 16  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 14 18  2  0
  7  6  1  1
  8 19  1  6
  4  5  1  1
  5 20  1  0
 20  2  1  0
  2 21  1  0
  1 22  1  0
 22 37  2  0
 36 23  2  0
 23 24  1  0
 24 25  2  0
 25 22  1  0
 21 26  1  0
 26 27  1  0
 26 28  1  1
 27 29  2  0
 27 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
  7 34  1  0
  4 35  1  0
 36 37  1  0
 23 38  1  0
M  END

Associated Targets(Human)

Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis C virus (23859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 579.90Molecular Weight (Monoisotopic): 579.1185AlogP: 1.63#Rotatable Bonds: 10
Polar Surface Area: 178.41Molecular Species: NEUTRALHBA: 11HBD: 4
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.70CX Basic pKa: CX LogP: 1.57CX LogD: 1.57
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: 0.12

References

1. Wang G, Dyatkina N, Prhavc M, Williams C, Serebryany V, Hu Y, Huang Y, Wan J, Wu X, Deval J, Fung A, Jin Z, Tan H, Shaw K, Kang H, Zhang Q, Tam Y, Stoycheva A, Jekle A, Smith DB, Beigelman L..  (2019)  Synthesis and Anti-HCV Activities of 4'-Fluoro-2'-Substituted Uridine Triphosphates and Nucleotide Prodrugs: Discovery of 4'-Fluoro-2'- C-methyluridine 5'-Phosphoramidate Prodrug (AL-335) for the Treatment of Hepatitis C Infection.,  62  (9): [PMID:30951311] [10.1021/acs.jmedchem.9b00143]

Source