The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-Dimethylamino-4-methoxy-5-((4-benzamidopyrimidin-2-yl)amino)phenyl)acrylamide ID: ALA4476791
PubChem CID: 155538664
Max Phase: Preclinical
Molecular Formula: C23H24N6O3
Molecular Weight: 432.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2nccc(NC(=O)c3ccccc3)n2)c(OC)cc1N(C)C
Standard InChI: InChI=1S/C23H24N6O3/c1-5-21(30)25-16-13-17(19(32-4)14-18(16)29(2)3)26-23-24-12-11-20(28-23)27-22(31)15-9-7-6-8-10-15/h5-14H,1H2,2-4H3,(H,25,30)(H2,24,26,27,28,31)
Standard InChI Key: LCNMSBACQVVJRJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
13.1280 -5.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1268 -6.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8416 -6.6153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5580 -6.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5552 -5.3714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8398 -4.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8374 -4.1372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1216 -3.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1192 -2.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4083 -4.1416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2732 -6.6133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9871 -6.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6988 -6.6115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4122 -6.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4113 -5.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6911 -4.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9807 -5.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6989 -7.4365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9844 -7.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6869 -4.1365 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9703 -3.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9662 -2.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2580 -4.1438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6785 -2.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8343 -2.4920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8322 -1.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1160 -1.2566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4004 -1.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4060 -2.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1245 -4.9581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8402 -5.3686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1222 -4.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
4 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
13 18 1 0
18 19 1 0
16 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 2 0
9 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 9 1 0
15 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.48Molecular Weight (Monoisotopic): 432.1910AlogP: 3.67#Rotatable Bonds: 8Polar Surface Area: 108.48Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.39CX Basic pKa: 3.51CX LogP: 3.80CX LogD: 3.80Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.22
References 1. Chen L, Chi F, Wang T, Wang N, Li W, Liu K, Shu X, Ma X, Xu Y.. (2018) The synthesis of 4-arylamido-2-arylaminoprimidines as potent EGFR T790M/L858R inhibitors for NSCLC., 26 (23-24): [PMID:30471829 ] [10.1016/j.bmc.2018.11.009 ]