N-(Cyclopropylmethyl)-2-(5-methoxy-2-methyl-1-(2-morpholinoethyl)-1H-indol-3-yl)acetamide

ID: ALA4476795

PubChem CID: 155538667

Max Phase: Preclinical

Molecular Formula: C22H31N3O3

Molecular Weight: 385.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)c(CC(=O)NCC1CC1)c(C)n2CCN1CCOCC1

Standard InChI:  InChI=1S/C22H31N3O3/c1-16-19(14-22(26)23-15-17-3-4-17)20-13-18(27-2)5-6-21(20)25(16)8-7-24-9-11-28-12-10-24/h5-6,13,17H,3-4,7-12,14-15H2,1-2H3,(H,23,26)

Standard InChI Key:  IONPPZRQCZJNJB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    2.5709   -5.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5697   -6.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2857   -6.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2839   -4.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0004   -5.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0006   -6.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7875   -6.4005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2710   -5.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7871   -5.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0406   -4.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8482   -4.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0433   -7.1812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8472   -7.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0925   -5.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1031   -8.1306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3975   -4.7150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5549   -8.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8077   -9.5173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6526   -9.6695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1614   -9.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9083   -8.2947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1027   -3.3231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9064   -3.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1607   -2.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7695   -1.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9884   -1.5721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8590   -4.9131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8580   -4.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  1  0
  7 12  1  0
 12 13  1  0
  8 14  1  0
 13 15  1  0
 11 16  2  0
 15 17  1  0
 15 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 11 22  1  0
 22 23  1  0
 23 24  1  0
 25 24  1  0
 26 25  1  0
 24 26  1  0
  1 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476795

    ---

Associated Targets(Human)

CNR1 Tclin Cannabinoid CB1 receptor (20913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CNR2 Tchem Cannabinoid CB2 receptor (16942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.51Molecular Weight (Monoisotopic): 385.2365AlogP: 2.36#Rotatable Bonds: 8
Polar Surface Area: 55.73Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.17CX LogP: 1.97CX LogD: 1.77
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.76Np Likeness Score: -1.43

References

1. Li J, Ji J, Xu R, Li Z..  (2019)  Indole compounds with N-ethyl morpholine moieties as CB2 receptor agonists for anti-inflammatory management of pain: synthesis and biological evaluation.,  10  (11): [PMID:32952995] [10.1039/C9MD00173E]

Source