The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(Cyclopropylmethyl)-2-(5-methoxy-2-methyl-1-(2-morpholinoethyl)-1H-indol-3-yl)acetamide ID: ALA4476795
PubChem CID: 155538667
Max Phase: Preclinical
Molecular Formula: C22H31N3O3
Molecular Weight: 385.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)c(CC(=O)NCC1CC1)c(C)n2CCN1CCOCC1
Standard InChI: InChI=1S/C22H31N3O3/c1-16-19(14-22(26)23-15-17-3-4-17)20-13-18(27-2)5-6-21(20)25(16)8-7-24-9-11-28-12-10-24/h5-6,13,17H,3-4,7-12,14-15H2,1-2H3,(H,23,26)
Standard InChI Key: IONPPZRQCZJNJB-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
2.5709 -5.3230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5697 -6.1510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2857 -6.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2839 -4.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0004 -5.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0006 -6.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7875 -6.4005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2710 -5.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7871 -5.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0406 -4.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8482 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0433 -7.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8472 -7.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0925 -5.7301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1031 -8.1306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3975 -4.7150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5549 -8.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8077 -9.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6526 -9.6695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1614 -9.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9083 -8.2947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1027 -3.3231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9064 -3.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1607 -2.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7695 -1.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9884 -1.5721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8590 -4.9131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8580 -4.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 1 0
7 12 1 0
12 13 1 0
8 14 1 0
13 15 1 0
11 16 2 0
15 17 1 0
15 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
11 22 1 0
22 23 1 0
23 24 1 0
25 24 1 0
26 25 1 0
24 26 1 0
1 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 385.51Molecular Weight (Monoisotopic): 385.2365AlogP: 2.36#Rotatable Bonds: 8Polar Surface Area: 55.73Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.17CX LogP: 1.97CX LogD: 1.77Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.76Np Likeness Score: -1.43
References 1. Li J, Ji J, Xu R, Li Z.. (2019) Indole compounds with N -ethyl morpholine moieties as CB2 receptor agonists for anti-inflammatory management of pain: synthesis and biological evaluation., 10 (11): [PMID:32952995 ] [10.1039/C9MD00173E ]