3-((1-Butyl-2,5-dioxopyrrolidin-3-ylidene)methyl)-N-(4-methoxyphenyl)benzamide

ID: ALA4476799

PubChem CID: 155538482

Max Phase: Preclinical

Molecular Formula: C24H26N2O4

Molecular Weight: 406.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCN1C(=O)C/C(=C\c2cccc(C(=O)Nc3ccc(OC)cc3)c2)C1=O

Standard InChI:  InChI=1S/C24H26N2O4/c1-3-4-5-13-26-22(27)16-19(24(26)29)15-17-7-6-8-18(14-17)23(28)25-20-9-11-21(30-2)12-10-20/h6-12,14-15H,3-5,13,16H2,1-2H3,(H,25,28)/b19-15+

Standard InChI Key:  BOKPRVJNEZUQOI-XDJHFCHBSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    7.2196  -13.6878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2184  -14.5151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9333  -14.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6497  -14.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6468  -13.6841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9314  -13.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3598  -13.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0758  -13.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1642  -14.4984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9719  -14.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3818  -13.9508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8273  -13.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9953  -12.5321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3103  -15.4193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1978  -13.8609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5050  -13.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5048  -12.4504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7906  -13.6881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0760  -13.2758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0795  -12.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3657  -12.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6503  -12.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6532  -13.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3675  -13.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9352  -12.0392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2214  -12.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5298  -13.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3498  -13.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6817  -12.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5018  -12.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
 12 13  2  0
 10 14  2  0
 11 15  1  0
  1 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 25 26  1  0
 15 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476799

    ---

Associated Targets(Human)

HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SW480 (6023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCM460 (247 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.48Molecular Weight (Monoisotopic): 406.1893AlogP: 4.28#Rotatable Bonds: 8
Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.99CX LogD: 3.99
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -0.86

References

1. Luo K, Bao Y, Liu F, Xiao C, Li K, Zhang C, Huang R, Lin J, Zhang J, Jin Y..  (2019)  Synthesis and biological evaluation of novel benzylidene-succinimide derivatives as noncytotoxic antiangiogenic inhibitors with anticolorectal cancer activity in vivo.,  179  [PMID:31295714] [10.1016/j.ejmech.2019.06.094]

Source