The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((1-Butyl-2,5-dioxopyrrolidin-3-ylidene)methyl)-N-(4-methoxyphenyl)benzamide ID: ALA4476799
PubChem CID: 155538482
Max Phase: Preclinical
Molecular Formula: C24H26N2O4
Molecular Weight: 406.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCN1C(=O)C/C(=C\c2cccc(C(=O)Nc3ccc(OC)cc3)c2)C1=O
Standard InChI: InChI=1S/C24H26N2O4/c1-3-4-5-13-26-22(27)16-19(24(26)29)15-17-7-6-8-18(14-17)23(28)25-20-9-11-21(30-2)12-10-20/h6-12,14-15H,3-5,13,16H2,1-2H3,(H,25,28)/b19-15+
Standard InChI Key: BOKPRVJNEZUQOI-XDJHFCHBSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
7.2196 -13.6878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2184 -14.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9333 -14.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6497 -14.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6468 -13.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9314 -13.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3598 -13.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0758 -13.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1642 -14.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9719 -14.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3818 -13.9508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8273 -13.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9953 -12.5321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3103 -15.4193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1978 -13.8609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5050 -13.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5048 -12.4504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7906 -13.6881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0760 -13.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0795 -12.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3657 -12.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6503 -12.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6532 -13.2799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3675 -13.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9352 -12.0392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2214 -12.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5298 -13.1056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3498 -13.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6817 -12.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5018 -12.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
12 13 2 0
10 14 2 0
11 15 1 0
1 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 1 0
15 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.48Molecular Weight (Monoisotopic): 406.1893AlogP: 4.28#Rotatable Bonds: 8Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.99CX LogD: 3.99Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -0.86
References 1. Luo K, Bao Y, Liu F, Xiao C, Li K, Zhang C, Huang R, Lin J, Zhang J, Jin Y.. (2019) Synthesis and biological evaluation of novel benzylidene-succinimide derivatives as noncytotoxic antiangiogenic inhibitors with anticolorectal cancer activity in vivo., 179 [PMID:31295714 ] [10.1016/j.ejmech.2019.06.094 ]