The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1S,3S)-3-(4-(4-(((4-chlorobenzyloxy)carbonylamino)methyl)-3-methylisoxazol-5-yl)phenoxy)cyclohexanecarboxylic acid ID: ALA4476814
PubChem CID: 155153661
Max Phase: Preclinical
Molecular Formula: C26H27ClN2O6
Molecular Weight: 498.96
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1noc(-c2ccc(O[C@H]3CCC[C@H](C(=O)O)C3)cc2)c1CNC(=O)OCc1ccc(Cl)cc1
Standard InChI: InChI=1S/C26H27ClN2O6/c1-16-23(14-28-26(32)33-15-17-5-9-20(27)10-6-17)24(35-29-16)18-7-11-21(12-8-18)34-22-4-2-3-19(13-22)25(30)31/h5-12,19,22H,2-4,13-15H2,1H3,(H,28,32)(H,30,31)/t19-,22-/m0/s1
Standard InChI Key: KQABZYOUYWUYDT-UGKGYDQZSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
32.1734 -5.3336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4622 -4.9182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7463 -5.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0309 -4.9170 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7456 -6.1582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3149 -5.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5996 -4.9159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5158 -4.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7082 -3.9255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2926 -4.6409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8461 -5.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6761 -6.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1307 -3.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9165 -3.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5276 -3.2526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3582 -2.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5683 -2.1898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9564 -2.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9730 -1.8940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7585 -2.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9230 -2.9550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7045 -3.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3224 -2.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1535 -1.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3666 -1.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1728 -6.1594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4608 -6.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4598 -7.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1716 -7.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8899 -7.3905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8874 -6.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8715 -4.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2582 -4.5609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6516 -4.2718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1710 -8.6309 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 2 0
4 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
11 7 1 0
11 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
8 13 1 0
16 19 1 0
20 19 1 1
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
1 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
22 32 1 6
32 33 2 0
32 34 1 0
29 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.96Molecular Weight (Monoisotopic): 498.1558AlogP: 5.75#Rotatable Bonds: 8Polar Surface Area: 110.89Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.36CX Basic pKa: 1.18CX LogP: 4.79CX LogD: 1.87Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.53