(1S,3S)-3-(4-(4-(((4-chlorobenzyloxy)carbonylamino)methyl)-3-methylisoxazol-5-yl)phenoxy)cyclohexanecarboxylic acid

ID: ALA4476814

PubChem CID: 155153661

Max Phase: Preclinical

Molecular Formula: C26H27ClN2O6

Molecular Weight: 498.96

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1noc(-c2ccc(O[C@H]3CCC[C@H](C(=O)O)C3)cc2)c1CNC(=O)OCc1ccc(Cl)cc1

Standard InChI:  InChI=1S/C26H27ClN2O6/c1-16-23(14-28-26(32)33-15-17-5-9-20(27)10-6-17)24(35-29-16)18-7-11-21(12-8-18)34-22-4-2-3-19(13-22)25(30)31/h5-12,19,22H,2-4,13-15H2,1H3,(H,28,32)(H,30,31)/t19-,22-/m0/s1

Standard InChI Key:  KQABZYOUYWUYDT-UGKGYDQZSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   32.1734   -5.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4622   -4.9182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7463   -5.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0309   -4.9170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7456   -6.1582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3149   -5.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5996   -4.9159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5158   -4.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7082   -3.9255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2926   -4.6409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8461   -5.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6761   -6.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1307   -3.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9165   -3.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5276   -3.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3582   -2.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5683   -2.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9564   -2.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9730   -1.8940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7585   -2.1481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9230   -2.9550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7045   -3.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3224   -2.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1535   -1.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3666   -1.5914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1728   -6.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4608   -6.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4598   -7.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1716   -7.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8899   -7.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8874   -6.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8715   -4.0141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2582   -4.5609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6516   -4.2718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1710   -8.6309    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
 11 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  8 13  1  0
 16 19  1  0
 20 19  1  1
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
  1 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 22 32  1  6
 32 33  2  0
 32 34  1  0
 29 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4476814

    ---

Associated Targets(Human)

LPAR1 Tchem Lysophosphatidic acid receptor Edg-2 (779 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.96Molecular Weight (Monoisotopic): 498.1558AlogP: 5.75#Rotatable Bonds: 8
Polar Surface Area: 110.89Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.36CX Basic pKa: 1.18CX LogP: 4.79CX LogD: 1.87
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.53

References

1. Abdel-Magid AF..  (2019)  Lysophosphatidic Acid Receptor 1 Antagonists for the Treatment of Fibrosis.,  10  (10): [PMID:31620221] [10.1021/acsmedchemlett.9b00429]

Source